Fluocinolone Acetonide
From DrugPedia: A Wikipedia for Drug discovery
|
|
| Fluocinolone Acetonide
| |
| Systematic (IUPAC) name | |
| (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one | |
| Identifiers | |
| CAS number | |
| ATC code | ? |
| PubChem | |
| DrugBank | |
| Chemical data | |
| Formula | C24H30F2O6 |
| Mol. mass | 452.488 g/mol |
| Physical data | |
| Solubility in water | 11(EST) at 25oC mg/mL |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | Hepatic, CYP3A4-mediated |
| Half life | 1.3 to 1.7 hours |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
C |
| Legal status | |
| Routes | Topical |
Fluocinolone acetonide is a corticosteroid primarily used in dermatology to reduce skin inflammation and relieve itching. It is a synthetic hydrocortisone derivative. The fluorine substitution at position 9 in the steroid nucleus greatly enhances its activity. A typical dosage strength used in dermatology is 0.01–0.025%. One such cream is sold under the brand name Flucort-N and includes the antibiotic neomycin.
A glucocorticoid derivative used topically in the treatment of various skin disorders. It is usually employed as a cream, gel, lotion, or ointment. It has also been used topically in the treatment of inflammatory eye, ear, and nose disorders. (From Martindale, The Extra Pharmacopoeia, 30th ed, p732)
[edit] General Properties
*Molecular Weight
452.49
*Molecular Formula
C24H30F2O6
*IUPAC NAME
*Canonical Smiles
CC1(OC2CC3C4CC(C5=CC(=O)C=CC5(C4(C(CC3(C2(O1)C(=O)CO)C)O)F)C)F)C
*Isomeric Smiles
CC1(O[C@@H]2C[C@H]3[C@@H]4C[C@@H](C5=CC(=O)C=C[C@@]5([C@]4([C@H](C[C@@]3([C@@]2(O1)C(=O)CO)C)O)F)C)F)C
[edit] PhysioChemical Properties
*Melting Point
265-266(EXP)
*LogP
2.48(EXP)
*Water Solubility
11(EST) at 25C
