| ID | 1944 |
| Name | Corydaline |
| Pubchem ID | 101301 |
| KEGG ID | C15530 |
| Source | Corydalis cava |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 369.45 |
| Exact mass | 369.194008 |
| Molecular formula | C22H27NO4 |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Isomeric SMILE | C[C@@H]1[C@@H]2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1945 |
| Name | Corydaline |
| Pubchem ID | 101301 |
| KEGG ID | C15530 |
| Source | Corydalis intermedia |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 369.45 |
| Exact mass | 369.194008 |
| Molecular formula | C22H27NO4 |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Isomeric SMILE | C[C@@H]1[C@@H]2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,54,(1989),2009 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1946 |
| Name | Corydaline |
| Pubchem ID | 101301 |
| KEGG ID | C15530 |
| Source | Corydalis nobilis |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 369.45 |
| Exact mass | 369.194008 |
| Molecular formula | C22H27NO4 |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Isomeric SMILE | C[C@@H]1[C@@H]2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,54,(1989),2009 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1947 |
| Name | Corydaline |
| Pubchem ID | 101301 |
| KEGG ID | C15530 |
| Source | Corydalis ochroleuca |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 369.45 |
| Exact mass | 369.194008 |
| Molecular formula | C22H27NO4 |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Isomeric SMILE | C[C@@H]1[C@@H]2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Ribar,Bull.Acad.Serbe Sci.Arts.Cl.Sci.Math.Nat.Sci.Nat.,40,(2003),95 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1948 |
| Name | Corydaline |
| Pubchem ID | 101301 |
| KEGG ID | C15530 |
| Source | Corydalis solida |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 369.45 |
| Exact mass | 369.194008 |
| Molecular formula | C22H27NO4 |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Isomeric SMILE | C[C@@H]1[C@@H]2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1949 |
| Name | Corydaline |
| Pubchem ID | 101301 |
| KEGG ID | C15530 |
| Source | Corydalis turtschaninowii |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 369.45 |
| Exact mass | 369.194008 |
| Molecular formula | C22H27NO4 |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Isomeric SMILE | C[C@@H]1[C@@H]2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Jo,Choson Minjujuui Inmin Konghwaguk Kwahagwon Tongbo,(2002),52 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1950 |
| Name | Corydaline |
| Pubchem ID | 101301 |
| KEGG ID | C15530 |
| Source | Corydalis yanhusuo |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 369.45 |
| Exact mass | 369.194008 |
| Molecular formula | C22H27NO4 |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Isomeric SMILE | C[C@@H]1[C@@H]2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Xu,Zhongguo Yaoke Daxue Xuebao,33,(2002),483 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1956 |
| Name | Corynoline |
| Pubchem ID | 177014 |
| KEGG ID | N/A |
| Source | Corydalis incisa |
| Type | Natural |
| Function | Acetylcholinesterase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 367.40 |
| Exact mass | 367.141973 |
| Molecular formula | C21H21NO5 |
| XlogP | 2.7 |
| Topological Polar Surface Area | 60.4 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC12C(CC3=CC4=C(C=C3C1N(CC5=C2C=CC6=C5OCO6)C)OCO4)O |
| Isomeric SMILE | C[C@]12[C@H](CC3=CC4=C(C=C3[C@H]1N(CC5=C2C=CC6=C5OCO6)C)OCO4)O |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |