| ID | 1990 |
| Name | Dauricine |
| Pubchem ID | 73400 |
| KEGG ID | C09419 |
| Source | Menispermum canadense |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | No |
| Molecular Weight | 624.77 |
| Exact mass | 624.319937 |
| Molecular formula | C38H44N2O6 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 72.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 10 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]-2-[4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1991 |
| Name | Dauricine |
| Pubchem ID | 73400 |
| KEGG ID | C09419 |
| Source | Menispermum dauricum |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | No |
| Molecular Weight | 624.77 |
| Exact mass | 624.319937 |
| Molecular formula | C38H44N2O6 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 72.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 10 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]-2-[4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2953 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Annona cherimola |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Chen,J.Chin.Chem.Soc.(Taipei),46,(1999),77 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2954 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Anomianthus dulcis |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Sinz,Biochem.Syst.Ecol.,28,(1998),139 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2955 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Antizoma angustifolia |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. De Wet,Biochem.Syst.Ecol.,32,(2004),1145 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2956 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Berberis sibirica |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Karimov,Khim.Prir.Soedin.,(1993),424 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2957 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Cocculus laurifolius |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2958 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Croton linearis |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2959 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2960 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Orophea hexandra |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Sinz,Biochem.Syst.Ecol.,27,(1999),111 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2961 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Papaver fugax |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Shafiee,J.Sci.Islamic Repub..Iran,8,(1997),166 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2962 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Plumula nelumbensis |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Wang,Zhongguo Zhongyao Zazhi,16,(1991),373 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2963 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Stephania glabra |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2964 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Thalictrum pedunculatum |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Hussain,J.Nat.Prod.,52,(1989),428 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |