| ID | 1047 |
| Name | 3-methoxysampangine |
| Pubchem ID | 122683 |
| KEGG ID | N/A |
| Source | Cleistopholis patens |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 262.26 |
| Exact mass | 262.074228 |
| Molecular formula | C16H10N2O2 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 52.1 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=CN=C2C3=CC=CC=C3C(=O)C4=NC=CC1=C24 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1078 |
| Name | Acetylcorynoline |
| Pubchem ID | 177015 |
| KEGG ID | N/A |
| Source | Corydalis bungeana |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 409.43 |
| Exact mass | 409.152537 |
| Molecular formula | C23H23NO6 |
| XlogP | 3.3 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC(=O)OC1CC2=CC3=C(C=C2C4C1(C5=C(CN4C)C6=C(C=C5)OCO6)C)OCO3 |
| Isomeric SMILE | CC(=O)O[C@H]1CC2=CC3=C(C=C2[C@@H]4[C@]1(C5=C(CN4C)C6=C(C=C5)OCO6)C)OCO3 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1325 |
| Name | Berberal |
| Pubchem ID | 9424 |
| KEGG ID | N/A |
| Source | Hydrastis canadensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | No |
| Molecular Weight | 768.79 |
| Exact mass | 768.198895 |
| Molecular formula | C40H36N2O12S |
| XlogP | N/A |
| Topological Polar Surface Area | 162 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 12 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[O-]S(=O)(=O)[O-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1379 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Hydrastis canadensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1380 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberidaceae |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1381 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Acangelisia gusanlung |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1382 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Asteropyrum cavaleriei |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1383 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis aemulans |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1384 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis candidula |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1385 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis croatica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1386 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis densiflora |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1387 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis heterobotrys |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1388 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis iliensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1389 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis integerrima |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1390 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis numularis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1391 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis oblonga |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1392 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis poirettii |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1393 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis pruinosa |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1394 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis rigidifolia |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1395 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis stenophylla |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1396 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis turcomanica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1397 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Berberis vulgaris |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1398 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Chelidonum majus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1399 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Coptis chinensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1400 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Coptis deltoides |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1401 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Coptis gulinensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1402 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Coptis japonica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1403 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Coptis omeiensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1404 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Corydalis intermedia |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1405 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Corydalis solida |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1406 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Coscinium fenestratum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1407 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Eschscholtzia california |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1408 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Glaucium arabicum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1409 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Mahonia aquifolium |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1410 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Mahonia japonica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1411 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Naravelia zeylandica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1412 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver albiflora |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1413 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver confine |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1414 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver pinnatifidum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1415 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver rhoeas |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1416 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1417 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papver stevenianum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1418 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Phellodendron amurense |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1419 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Phellodendron wilsonii |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1420 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Ranunculus serbicus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1421 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Stylophorum lasiocarpum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1422 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum flavum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1423 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum foetidum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1424 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum honanense |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1425 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1426 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum orientale |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1427 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum przewalskii |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1428 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum purpurescens |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1429 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum wanqii |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1430 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Xanthorhiza simplicissima |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1488 |
| Name | Berberine chloride |
| Pubchem ID | 12456 |
| KEGG ID | C12679 |
| Source | Hydrastis canadensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | No |
| Molecular Weight | 371.81 |
| Exact mass | 371.092436 |
| Molecular formula | C20H18ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1978 |
| Name | Cycleanine |
| Pubchem ID | 121313 |
| KEGG ID | N/A |
| Source | Stephania epigeae |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | No |
| Molecular Weight | 622.75 |
| Exact mass | 622.304287 |
| Molecular formula | C38H42N2O6 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 61.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC=C(O3)C=C7)N(CCC6=CC(=C5OC)OC)C)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC=C(O3)C=C7)N(CCC6=CC(=C5OC)OC)C)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2020 |
| Name | Dicentrine |
| Pubchem ID | 101300 |
| KEGG ID | N/A |
| Source | Cassytha filiformis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.2 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C2C1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2469 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Enantia chlorantha |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Moody,Pharm.Pharmacol.Lett.,5,(1995),80 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2470 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Acangelisia gusanlung |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Zhang,Planta Med.,57,(1991),457 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2471 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis aemulans |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lu,Yaoxue Xuebao,30,(1995),280 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2472 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis cratagina |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Telezhenetskaya,Khim.Prir.Soedin.,(1996),106 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2473 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis heterobotrys |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Karimov,Khim.Prir.Soedin.(1993),869 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2474 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis julianae |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Yuan,Tianran Chanwu Yanju Yu Kaifa,4,(1992),1 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2475 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis poirettii |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lu,Yaoxue Xuebao,30,(1995),280 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2476 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis pruinosa |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lu,Yaoxue Xuebao,30,(1995),280 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2477 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis turcomanica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Karimov,Khim.Prir.Soedin.,(1993),77 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2478 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Berberis vulgaris |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Suau,Phytochem.,49,(1998),2545 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2479 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Chelidonum majus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Niu,Yaoxye Xuebao,27,(1992),69 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2480 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Coptis japonica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Yoneda,Shoyakugaku Zasshi,44,(1990),196 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2481 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Enantia chlorantha |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Moody,Pharm.Pharmacol.Lett.,5,(1995),80 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2482 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Glaucium arabicum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Al-Khalil,Dirasat.Univ.Jordan B.,17,(1990),185 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2483 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Jateorhiza palmata |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2484 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Mahonia aquifolium |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Vollekova,Phytother.Res.,17,(2003),834 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2485 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Mahonia japonica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Hsieh,J.Chin.Chem.Soc.,51,(2004),443 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2486 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Thalictrum honanense |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Han,Zhongguo Zhongyao Zazhi,18,(1993),615 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2487 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,57,(1992),573 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2488 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2489 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Zanthoxylum chaylbeum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2506 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Alphonsea mollis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Xie,Zhongguo Yaoke Daxue Xuebao,20,(1989),321 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2507 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Anisocycla racemosa |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Kanyinda,Planta Med.,55,(1989),394 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2508 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona cherimola |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Chen,J.Chin.Chem.Soc.(Taipei),48,(2001),1203 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2509 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona cherimolia |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Simeon,Plant Med.Phytother.,23,(1989),159 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2510 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona dioica |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Dos,J.Braz.Chem.Soc.,14,(2003),396 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2511 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona glabra |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Chang,J.Chin.Chem.Soc.(Taipei),47,(2000),913 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2512 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona montana |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Wu,Phytochem.,33,(1993),497 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2513 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona purpurea |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Chang,J.Nat.Prod.,63,(2000),746 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2514 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona reticulata |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Chang,Chim.Pharm.J.(Taipei),47,(1995),483 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2515 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Annona senegalensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. PHilipov,Fitoterapia,66,(1995),275 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2516 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Artabotrys uncinatus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Wu,Phytochem.,28,(1989),2191 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2517 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Atrabotrys maingayi |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Cortes,J.Nat.Prod.,53,(1990),503 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2518 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Cananga odorata |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Yang,Chung-hua Yao Hsueh Tsa Chih.,41,(1989),279 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2519 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Cardiopetalum calophyllum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Seguineau,Planta Med.,57,(1991),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2520 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Cissampelos sympodialis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Avlves,Fitoterapia,73,(2002),356 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2521 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Cleistopholis patens |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Liu,Antimicrob.Agents Chemother.,34,(1990),529 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2522 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Desmos longifolia |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Hossain,Fitoterapia,16,(1995),463 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2523 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Disepalum pulchrum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lavault,Phytochem.,29,(1990),3845 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2524 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Enantia chlorantha |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Samir,Bull.Fac.Sci.Assiut.Univ.,18,(1989),21 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2525 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Fissistigma glaucescens |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Chang,J.Chin.Chem.Soc.(Taipei),47,(2000),1251 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2526 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Goniothalamus amuyon |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lan,Chem.Pharm.Bull.,55,(2006),1040 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2527 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Goniothalamus scortephanine |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Bin,Int.J.Crude Drugs,27,(1989),92 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2528 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Goniothalamus topis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Bin,Int.J.Crude Drugs,27,(1989),92 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2529 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Guatteria oliviformis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lopez,Phytochem.,29,(1990),1899 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2530 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Illigera luzonensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Chen,J.Nat.Prod.,60,(1997),645 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2531 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Lettowianthus stellatus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Nkunya,Phytochem.,53,(2000),1067 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2532 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Liriodendron tulipifera |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2533 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Magnolia abovata |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Sturua,Bull.Georgian Acad.Sci.,154,(1996),75 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2534 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Magnolia obovata |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2535 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Miliusa cuneata |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Chen,Nat.Prod.Res.,17,(2003),397 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2536 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Miliusa velutina |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Jumana,Biochem.Syst.Ecol.,28,(2000),483 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2537 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Oncodostigma monosperma |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Bou-Abdallah,J.Nat.Prod.,52,(1989),273 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2538 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Papaver caucasicum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Shafiee,J.Sci.Islamic Repub.Iran,7,(1996),263 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2539 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Piptostigma fugax |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Aschenbach,Phytochem.,38,(1994),1037 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2540 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Polyalthia insignis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lee,Tetrahedron Lett.,38,(1997),1253 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2541 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Polyalthia longifolia |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Wu,J.Nat.Prod.,53,(1990),1327 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2542 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Polyalthia macropoda |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lavault,Phytochem.,29,(1990),3845 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2543 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Polyalthia stenopetala |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lavault,Phytochem.,29,(1990),3845 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2544 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Siparuna tonduziana |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Lopez,Planta Med.,56,(1990),492 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2545 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Stephania dinklagei |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Camacho,Planta Med.,66,(2000),478 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2546 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Talauma gitigensis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Nonato,J.Nat.Prod.,53,(1990),1623 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2547 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Trivalvaria macrophylla |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Cortes,J.Nat.Prod.,53,(1990),862 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2548 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Xanthorhiza simplicissima |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Wu,Kao-Hsiung I.Hsuek K'o Hsueh Tsa Chih,5,(1989),409 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2549 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Zanthoxylum caudatum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Nissanka,Phytochem.,56,(2001),857 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2550 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Zanthoxylum tetraspermum |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2551 |
| Name | Liriodenine methiodide |
| Pubchem ID | 122772 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Antifungal |
| Drug Like Properties | No |
| Molecular Weight | 417.20 |
| Exact mass | 416.986186 |
| Molecular formula | C18H12INO3 |
| XlogP | N/A |
| Topological Polar Surface Area | 39.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C3=C(C4=CC=CC=C4C2=O)C5=C(C=C3C=C1)OCO5.[I-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2806 |
| Name | Norsanguinarine |
| Pubchem ID | 97679 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 317.29 |
| Exact mass | 317.068808 |
| Molecular formula | C19H11NO4 |
| XlogP | 4.3 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=CN=C4C(=C3C=C2)C=CC5=CC6=C(C=C54)OCO6 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3190 |
| Name | Sanguinarine |
| Pubchem ID | 68635 |
| KEGG ID | D05799 |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | No |
| Molecular Weight | 367.78 |
| Exact mass | 367.061136 |
| Molecular formula | C20H14ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3191 |
| Name | Sanguinarine |
| Pubchem ID | 68635 |
| KEGG ID | D05799 |
| Source | Sanguinaria |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | No |
| Molecular Weight | 367.78 |
| Exact mass | 367.061136 |
| Molecular formula | C20H14ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |