ID | 1098 |
Name | Alangicine |
Pubchem ID | 5460436 |
KEGG ID | C09327 |
Source | Alangium lamarckii |
Type | Natural |
Function | Antileprotic |
Drug Like Properties | Yes |
Molecular Weight | 480.60 |
Exact mass | 480.262422 |
Molecular formula | C28H36N2O5 |
XlogP | 3.6 |
Topological Polar Surface Area | 80.3 |
H-Bond Donor | 2 |
H-Bond Acceptor | 7 |
Rotational Bond Count | 6 |
IUPAC Name | 1-[[(2R,3R,11bS)-3-ethyl-8-hydroxy-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinolin-2-yl]methyl]-7-methoxy-3,4-dihydro-2H-isoquinolin-6-one |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=C(C(=C(C=C3C2CC1CC4=C5C=C(C(=O)C=C5CCN4)OC)OC)OC)O |
Isomeric SMILE | CC[C@H]1CN2CCC3=C(C(=C(C=C3[C@@H]2C[C@@H]1CC4=C5C=C(C(=O)C=C5CCN4)OC)OC)OC)O |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 1102 |
Name | Alangimarine |
Pubchem ID | 442160 |
KEGG ID | C09329 |
Source | Alangium lamarckii |
Type | Natural |
Function | Antileprotic |
Drug Like Properties | Yes |
Molecular Weight | 320.34 |
Exact mass | 320.116092 |
Molecular formula | C19H16N2O3 |
XlogP | 2.5 |
Topological Polar Surface Area | 62.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C=C2C(=C1)CCN3C2=CC4=C(C=NC=C4C3=O)C=C)O |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |