| ID | 1150 |
| Name | Ancistrocladine |
| Pubchem ID | 161741 |
| KEGG ID | C09335 |
| Source | Ancistrocladus abbreviatus |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 407.50 |
| Exact mass | 407.209658 |
| Molecular formula | C25H29NO4 |
| XlogP | 5 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (1S,3S)-5-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1CC2=C(C(=CC(=C2C(N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Isomeric SMILE | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Drugpedia | wiki |
| References | 1. Bringmann,Phytochem.,31,(1992),4011 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1151 |
| Name | Ancistrocladine |
| Pubchem ID | 161741 |
| KEGG ID | C09335 |
| Source | Ancistrocladus congolensis |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 407.50 |
| Exact mass | 407.209658 |
| Molecular formula | C25H29NO4 |
| XlogP | 5 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (1S,3S)-5-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1CC2=C(C(=CC(=C2C(N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Isomeric SMILE | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1152 |
| Name | Ancistrocladine |
| Pubchem ID | 161741 |
| KEGG ID | C09335 |
| Source | Ancistrocladus hamatus |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 407.50 |
| Exact mass | 407.209658 |
| Molecular formula | C25H29NO4 |
| XlogP | 5 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (1S,3S)-5-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1CC2=C(C(=CC(=C2C(N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Isomeric SMILE | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1153 |
| Name | Ancistrocladine |
| Pubchem ID | 161741 |
| KEGG ID | C09335 |
| Source | Ancistrocladus heyneanus |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 407.50 |
| Exact mass | 407.209658 |
| Molecular formula | C25H29NO4 |
| XlogP | 5 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (1S,3S)-5-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1CC2=C(C(=CC(=C2C(N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Isomeric SMILE | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1154 |
| Name | Ancistrocladine |
| Pubchem ID | 161741 |
| KEGG ID | C09335 |
| Source | Ancistrocladus qriffithii |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 407.50 |
| Exact mass | 407.209658 |
| Molecular formula | C25H29NO4 |
| XlogP | 5 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (1S,3S)-5-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1CC2=C(C(=CC(=C2C(N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Isomeric SMILE | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Drugpedia | wiki |
| References | 1. Bringmann,Phytochem.,61,(2002),195 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1155 |
| Name | Ancistrocladine |
| Pubchem ID | 161741 |
| KEGG ID | C09335 |
| Source | Ancistrocladus robertsoniorum |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 407.50 |
| Exact mass | 407.209658 |
| Molecular formula | C25H29NO4 |
| XlogP | 5 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (1S,3S)-5-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1CC2=C(C(=CC(=C2C(N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Isomeric SMILE | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Drugpedia | wiki |
| References | 1. Bringmann,Phytochem.,47,(1998),31 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1156 |
| Name | Ancistrocladine |
| Pubchem ID | 161741 |
| KEGG ID | C09335 |
| Source | Ancistrocladus tanzaniensis |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 407.50 |
| Exact mass | 407.209658 |
| Molecular formula | C25H29NO4 |
| XlogP | 5 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (1S,3S)-5-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC1CC2=C(C(=CC(=C2C(N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Isomeric SMILE | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)OC)O)C3=C4C=CC=C(C4=C(C=C3C)OC)OC |
| Drugpedia | wiki |
| References | 1. Bringmann,J.Nat.Prod.,66,(2003),1159 2. Bringmann,J.Nat.Prod.,67,(2004),743 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 1231 |
| Name | Asimilobine-2-O-glucoside |
| Pubchem ID | 158546 |
| KEGG ID | N/A |
| Source | Stephania pierrei |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 429.46 |
| Exact mass | 429.178752 |
| Molecular formula | C23H27NO7 |
| XlogP | 0.8 |
| Topological Polar Surface Area | 121 |
| H-Bond Donor | 5 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2CCNC3C2=C1C4=CC=CC=C4C3)OC5C(C(C(C(O5)CO)O)O)O |
| Isomeric SMILE | COC1=C(C=C2CCN[C@H]3C2=C1C4=CC=CC=C4C3)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1259 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Buxus sempervirens |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1260 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Chondrodendron candicans |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1261 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Chondrodendron platyphyllum |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1262 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Chondrodendron tomentosum |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1263 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Cissampelos pareira |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1264 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Nectandra rodioei |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1999 |
| Name | Dehydrocrebanine |
| Pubchem ID | 149600 |
| KEGG ID | N/A |
| Source | Stephania venosa |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 337.37 |
| Exact mass | 337.131408 |
| Molecular formula | C20H19NO4 |
| XlogP | 4.3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C5C=CC(=C(C5=CC1=C24)OC)OC)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2000 |
| Name | Dehydrocrebanine |
| Pubchem ID | 149600 |
| KEGG ID | N/A |
| Source | Prismatomeris sessiliflora |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 337.37 |
| Exact mass | 337.131408 |
| Molecular formula | C20H19NO4 |
| XlogP | 4.3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C5C=CC(=C(C5=CC1=C24)OC)OC)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2001 |
| Name | Dehydrocrebanine |
| Pubchem ID | 149600 |
| KEGG ID | N/A |
| Source | Diospyros montana |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 337.37 |
| Exact mass | 337.131408 |
| Molecular formula | C20H19NO4 |
| XlogP | 4.3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C5C=CC(=C(C5=CC1=C24)OC)OC)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2002 |
| Name | Dehydrocrebanine |
| Pubchem ID | 149600 |
| KEGG ID | N/A |
| Source | Murraya siamensis |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 337.37 |
| Exact mass | 337.131408 |
| Molecular formula | C20H19NO4 |
| XlogP | 4.3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C5C=CC(=C(C5=CC1=C24)OC)OC)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2003 |
| Name | Dehydrostephanine |
| Pubchem ID | 156870 |
| KEGG ID | N/A |
| Source | Stephania kwangsiensis |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 307.34 |
| Exact mass | 307.120843 |
| Molecular formula | C19H17NO3 |
| XlogP | 4.4 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C5C=CC=C(C5=CC1=C24)OC)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2156 |
| Name | Fagaridine |
| Pubchem ID | 177893 |
| KEGG ID | C09430 |
| Source | Macleaya cordata |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 334.35 |
| Exact mass | 334.107933 |
| Molecular formula | C20H16NO4+ |
| XlogP | 4.3 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC(=C(C3=C1)O)OC)C=CC4=CC5=C(C=C42)OCO5 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Tolkachev,Pharm.Chem.J.,33,(1999),86 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2157 |
| Name | Fagaridine |
| Pubchem ID | 177893 |
| KEGG ID | C09430 |
| Source | Zanthoxylum tessmanii |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 334.35 |
| Exact mass | 334.107933 |
| Molecular formula | C20H16NO4+ |
| XlogP | 4.3 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC(=C(C3=C1)O)OC)C=CC4=CC5=C(C=C42)OCO5 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2279 |
| Name | Homotrilobin |
| Pubchem ID | 33352 |
| KEGG ID | N/A |
| Source | Stephania japonica |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 576.68 |
| Exact mass | 576.262422 |
| Molecular formula | C36H36N2O5 |
| XlogP | 6.3 |
| Topological Polar Surface Area | 52.6 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C4=C2C1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)CC7C8=CC(=C(O3)C=C8CCN7C)O4)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2800 |
| Name | Nordicentrine |
| Pubchem ID | 168363 |
| KEGG ID | N/A |
| Source | Stephania pierrei |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 325.36 |
| Exact mass | 325.131408 |
| Molecular formula | C19H19NO4 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 49 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2C(=C1)CC3C4=C2C5=C(C=C4CCN3)OCO5)OC |
| Isomeric SMILE | COC1=C(C=C2C(=C1)C[C@H]3C4=C2C5=C(C=C4CCN3)OCO5)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2966 |
| Name | Protoberberine |
| Pubchem ID | 114943 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 232.30 |
| Exact mass | 232.112624 |
| Molecular formula | C17H14N+ |
| XlogP | 3.9 |
| Topological Polar Surface Area | 3.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 0 |
| Rotational Bond Count | 0 |
| IUPAC Name | 5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1C[N+]2=CC3=CC=CC=C3C=C2C4=CC=CC=C41 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3406 |
| Name | Thalifaberidine |
| Pubchem ID | 157828 |
| KEGG ID | N/A |
| Source | Thalictrum faberi |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 668.78 |
| Exact mass | 668.309766 |
| Molecular formula | C39H44N2O8 |
| XlogP | 6 |
| Topological Polar Surface Area | 102 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 10 |
| Rotational Bond Count | 9 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=C(C(=C(C3=C2C1CC4=C(C(=C(C=C43)OC)O)OC5=CC=C(C=C5)CC6C7=CC(=C(C=C7CCN6C)O)OC)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=C(C(=C(C3=C2[C@@H]1CC4=C(C(=C(C=C43)OC)O)OC5=CC=C(C=C5)C[C@H]6C7=CC(=C(C=C7CCN6C)O)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3432 |
| Name | Tiliacorine |
| Pubchem ID | 442369 |
| KEGG ID | C09667 |
| Source | Tiliacora acuminata |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 576.68 |
| Exact mass | 576.262422 |
| Molecular formula | C36H36N2O5 |
| XlogP | 6.1 |
| Topological Polar Surface Area | 63.6 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C4C=C2C1CC5=CC(=C(C=C5)O)C6=C(C=CC(=C6)CC7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)OC |
| Isomeric SMILE | CN1CCC2=CC3=C4C=C2[C@@H]1CC5=CC(=C(C=C5)O)C6=C(C=CC(=C6)C[C@H]7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3433 |
| Name | Tiliacorine |
| Pubchem ID | 442369 |
| KEGG ID | C09667 |
| Source | Tiliacora racemosa |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 576.68 |
| Exact mass | 576.262422 |
| Molecular formula | C36H36N2O5 |
| XlogP | 6.1 |
| Topological Polar Surface Area | 63.6 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C4C=C2C1CC5=CC(=C(C=C5)O)C6=C(C=CC(=C6)CC7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)OC |
| Isomeric SMILE | CN1CCC2=CC3=C4C=C2[C@@H]1CC5=CC(=C(C=C5)O)C6=C(C=CC(=C6)C[C@H]7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3434 |
| Name | Tiliacorine |
| Pubchem ID | 442369 |
| KEGG ID | C09667 |
| Source | Tiliacora triandra |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 576.68 |
| Exact mass | 576.262422 |
| Molecular formula | C36H36N2O5 |
| XlogP | 6.1 |
| Topological Polar Surface Area | 63.6 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C4C=C2C1CC5=CC(=C(C=C5)O)C6=C(C=CC(=C6)CC7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)OC |
| Isomeric SMILE | CN1CCC2=CC3=C4C=C2[C@@H]1CC5=CC(=C(C=C5)O)C6=C(C=CC(=C6)C[C@H]7C8=C(O4)C(=C(C=C8CCN7C)OC)O3)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |