| ID | 3223 |
| Name | Sinomenine |
| Pubchem ID | 5459308 |
| KEGG ID | C09643 |
| Source | Sinomenium acutum |
| Type | Natural |
| Function | Antineuralgic |
| Drug Like Properties | Yes |
| Molecular Weight | 329.39 |
| Exact mass | 329.162708 |
| Molecular formula | C19H23NO4 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 59 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC23CC(=O)C(=CC2C1CC4=C3C(=C(C=C4)OC)O)OC |
| Isomeric SMILE | CN1CC[C@@]23CC(=O)C(=C[C@@H]2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3224 |
| Name | Sinomenine |
| Pubchem ID | 5459308 |
| KEGG ID | C09643 |
| Source | Cocculus laurifolius |
| Type | Natural |
| Function | Antineuralgic |
| Drug Like Properties | Yes |
| Molecular Weight | 329.39 |
| Exact mass | 329.162708 |
| Molecular formula | C19H23NO4 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 59 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC23CC(=O)C(=CC2C1CC4=C3C(=C(C=C4)OC)O)OC |
| Isomeric SMILE | CN1CC[C@@]23CC(=O)C(=C[C@@H]2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3225 |
| Name | Sinomenine |
| Pubchem ID | 5459308 |
| KEGG ID | C09643 |
| Source | Sinomenium acutum |
| Type | Natural |
| Function | Antineuralgic |
| Drug Like Properties | Yes |
| Molecular Weight | 329.39 |
| Exact mass | 329.162708 |
| Molecular formula | C19H23NO4 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 59 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC23CC(=O)C(=CC2C1CC4=C3C(=C(C=C4)OC)O)OC |
| Isomeric SMILE | CN1CC[C@@]23CC(=O)C(=C[C@@H]2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3226 |
| Name | Sinomenine |
| Pubchem ID | 5459308 |
| KEGG ID | C09643 |
| Source | Stephania cepharantha |
| Type | Natural |
| Function | Antineuralgic |
| Drug Like Properties | Yes |
| Molecular Weight | 329.39 |
| Exact mass | 329.162708 |
| Molecular formula | C19H23NO4 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 59 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC23CC(=O)C(=CC2C1CC4=C3C(=C(C=C4)OC)O)OC |
| Isomeric SMILE | CN1CC[C@@]23CC(=O)C(=C[C@@H]2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC |
| Drugpedia | wiki |
| References | 1. Polson,J.Periodontol,68,(1997),119 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |