ID | 1731 |
Name | Cephalotaxine |
Pubchem ID | 278679 |
KEGG ID | N/A |
Source | Cephalotaxus harringtonia |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 315.36 |
Exact mass | 315.147058 |
Molecular formula | C18H21NO4 |
XlogP | 0.2 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=CC23CCCN2CCC4=CC5=C(C=C4C3C1O)OCO5 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2091 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Uragoga ipecacuanha |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2092 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Uragoga acuminata |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2093 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Alangium longiflorum |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2094 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis acuminata |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2095 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |