ID | 2062 |
Name | Emetamine |
Pubchem ID | 442217 |
KEGG ID | C09420 |
Source | Cephaelis acuminata |
Type | Natural |
Function | Emetic |
Drug Like Properties | No |
Molecular Weight | 476.61 |
Exact mass | 476.267508 |
Molecular formula | C29H36N2O4 |
XlogP | 5.4 |
Topological Polar Surface Area | 53.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2R,3R,11bS)-2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2063 |
Name | Emetamine |
Pubchem ID | 442217 |
KEGG ID | C09420 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Emetic |
Drug Like Properties | No |
Molecular Weight | 476.61 |
Exact mass | 476.267508 |
Molecular formula | C29H36N2O4 |
XlogP | 5.4 |
Topological Polar Surface Area | 53.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2R,3R,11bS)-2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |