| ID | 1518 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Dicentra cucullaria |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1519 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Adlumia fungosa |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1520 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Ceratocapnos palaestinus |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Herath,J.Nat.Prod.,53,(1990),1006 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1521 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis caucasia |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Denisenko,Khim.Prir.Soedin.,(1991),439 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1522 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis esquirolii |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Li,Zhongcayao,22,(1991),486 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1523 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis hsuchowensis |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Zhou,Planta Med.,57,(1991),156 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1524 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis incisa |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1525 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis intermedia |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,54,(1989),2009 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1526 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis lutea |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Yang,Phytochem.,33,(1993),943 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1527 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis majori |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Allais,Plant Med.Phytother,22,(1988),219 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1528 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis nobilis |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,54,(1989),2009 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1529 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis omeiensis |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Xia,Zhongguo Yaoxue Zazhi,25,(1990),716 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1530 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis racemosa |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Joshi,Planta Med.,56,(1990),418 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1531 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis solida |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Sener,J.Chem.Soc.Pak.,13,(1991),63 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1532 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis thalictrifolia |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1533 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis thyrsifolia |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Li,Yaoxue Xuebao,26,(1991),303 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1534 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Fumaria bastardii |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Kucukboyaci,Nat.Prod.Sci.,4,(1998),257 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1552 |
| Name | Bicuculline |
| Pubchem ID | 6958650 |
| KEGG ID | N/A |
| Source | Dicentra cucullaria |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 368.36 |
| Exact mass | 368.113412 |
| Molecular formula | C20H18NO6+ |
| XlogP | 2.6 |
| Topological Polar Surface Area | 67.7 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[NH+]1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | C[NH+]1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1554 |
| Name | Bicuculline methiodide |
| Pubchem ID | 104871 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | GABA-A antagonist |
| Drug Like Properties | No |
| Molecular Weight | 509.29 |
| Exact mass | 509.03353 |
| Molecular formula | C21H20INO6 |
| XlogP | N/A |
| Topological Polar Surface Area | 63.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one iodide |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3)C.[I-] |
| Isomeric SMILE | C[N+]1(CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3)C.[I-] |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1938 |
| Name | Coreximine |
| Pubchem ID | 601259 |
| KEGG ID | N/A |
| Source | Guatteriopsis friesiana |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 327.37 |
| Exact mass | 327.147058 |
| Molecular formula | C19H21NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 62.2 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | 3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,11-diol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2C3CC4=CC(=C(C=C4CN3CCC2=C1)OC)O)O |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |