| ID | 1217 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Aniba canelilla |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Oger,Can.J.Chem.,71,(1993),1128 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1218 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Berberis integerrima |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Karimov,Kim.Prir.Soedin.,(1993),70 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1219 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Berberis turcomanica |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Karimov,Khim.Prir.Soedin.,(1993),77 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1220 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Euonymus europaea |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1221 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1222 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Papaver caucasicum |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1223 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Papaver persicum |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1224 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Phoebe minutiflora |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Huang,Chin.Pharm.J.(Taipei),49,(1997),217 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1225 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Rhamnus frangula |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1226 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Roemeria refracta |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Gozler,J.Nat.Prod.,53,(1990),666 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |