| ID | 1136 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina americana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Aguilar,Phytochem.,20,(1981),2061 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1137 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina brevifolia |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Aguilar,Fitoterapia,64,(1993),383 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1138 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina chiapasana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1139 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina coralloides |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1140 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina globocalyx |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1141 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina salviiflora |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Jackson,Allertonia,3,(1982),39 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1142 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina standleyana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1143 |
| Name | Alpha-Erythroidine |
| Pubchem ID | 441076 |
| KEGG ID | C06531 |
| Source | Erythrina tholloniana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | 0.4 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4C3=CC(=O)OC4)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CC[C@H]4C3=CC(=O)OC4)C=C1 |
| Drugpedia | wiki |
| References | 1. Chawla,Phytochem.,24,(1985),1821 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1254 |
| Name | Atracurium |
| Pubchem ID | 23641207 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 1086.31 |
| Exact mass | 1085.504466 |
| Molecular formula | C59H77N2O15S+ |
| XlogP | N/A |
| Topological Polar Surface Area | 184 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 15 |
| Rotational Bond Count | 26 |
| IUPAC Name | benzenesulfonate;5-[3-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoyloxy]pentyl3-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoate |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC)CCC(=O)OCCCCCOC(=O)CC[N+]4(CCC5=CC(=C(C=C5C4CC6=CC(=C(C=C6)OC)OC)OC)OC)C.C1=CC=C(C=C1)S(=O)(=O)[O-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1255 |
| Name | Atracurium |
| Pubchem ID | 47319 |
| KEGG ID | C07548 |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 929.14 |
| Exact mass | 928.508526 |
| Molecular formula | C53H72N2O12+2 |
| XlogP | 7.9 |
| Topological Polar Surface Area | 126 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 12 |
| Rotational Bond Count | 26 |
| IUPAC Name | 5-[3-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoyloxy]pentyl3-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoate |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC)CCC(=O)OCCCCCOC(=O)CC[N+]4(CCC5=CC(=C(C=C5C4CC6=CC(=C(C=C6)OC)OC)OC)OC)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1497 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina americana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Aguilar,Phytochem.,20,(1981),2061 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1498 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina arborescens |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Ghosal,Phytochem.,11,(1972),2101 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1499 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina chiapasana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1500 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina coralloides |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1501 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina globocalyx |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1502 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina salviiflora |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Jackson,Allertonia,3,(1982),39 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1503 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina standleyana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1504 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina tholloniana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Chawla,Phytochem.,24,(1985),1821 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1505 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina variegata |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Ghosal,Aust. J. Chem.,24,(1971),2733 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1677 |
| Name | Calebassine |
| Pubchem ID | 6433496 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 616.83 |
| Exact mass | 616.377727 |
| Molecular formula | C40H48N4O2+2 |
| XlogP | 3.7 |
| Topological Polar Surface Area | 46.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5C3(N(C6C5N7C8=CC=CC=C8C91C7(C6C2CC9[N+](CC1)(CC2=CC)C)O)C1=CC=CC=C41)O)C |
| Isomeric SMILE | C/C=C/1C2C3C4(N(C5=CC=CC=C5C46C(C2)[N+](C1)(CC6)C)C7C3N8C9(C7C1/C(=CC)/C[N+]2(C(C9(C3=CC=CC=C83)CC2)C1)C)O)O |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1696 |
| Name | C-Curarine |
| Pubchem ID | 5281386 |
| KEGG ID | C09144 |
| Source | Strychnos divaricans |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 596.80 |
| Exact mass | 596.351512 |
| Molecular formula | C40H44N4O+2 |
| XlogP | 3.7 |
| Topological Polar Surface Area | 15.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7=CC=CC=C7C89C61C(=CN(C53O1)C1=CC=CC=C41)C1CC8[N+](CC9)(CC1=CC)C)C |
| Isomeric SMILE | C/C=C/1[C@H]2C3=CN4[C@@]56O[C@]37N(C8=CC=CC=C8[C@]79[C@H](C2)[N@+](C1)(CC9)C)C=C5[C@@H]1/C(=CC)/C[N@+]2([C@H]([C@]6(C3=CC=CC=C43)CC2)C1)C |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |
| ID | 1697 |
| Name | C-Curarine |
| Pubchem ID | 5281386 |
| KEGG ID | C09144 |
| Source | Strychnos froesii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 596.80 |
| Exact mass | 596.351512 |
| Molecular formula | C40H44N4O+2 |
| XlogP | 3.7 |
| Topological Polar Surface Area | 15.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7=CC=CC=C7C89C61C(=CN(C53O1)C1=CC=CC=C41)C1CC8[N+](CC9)(CC1=CC)C)C |
| Isomeric SMILE | C/C=C/1[C@H]2C3=CN4[C@@]56O[C@]37N(C8=CC=CC=C8[C@]79[C@H](C2)[N@+](C1)(CC9)C)C=C5[C@@H]1/C(=CC)/C[N@+]2([C@H]([C@]6(C3=CC=CC=C43)CC2)C1)C |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |
| ID | 1698 |
| Name | C-Curarine |
| Pubchem ID | 5281386 |
| KEGG ID | C09144 |
| Source | Strychnos mittschelichii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 596.80 |
| Exact mass | 596.351512 |
| Molecular formula | C40H44N4O+2 |
| XlogP | 3.7 |
| Topological Polar Surface Area | 15.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7=CC=CC=C7C89C61C(=CN(C53O1)C1=CC=CC=C41)C1CC8[N+](CC9)(CC1=CC)C)C |
| Isomeric SMILE | C/C=C/1[C@H]2C3=CN4[C@@]56O[C@]37N(C8=CC=CC=C8[C@]79[C@H](C2)[N@+](C1)(CC9)C)C=C5[C@@H]1/C(=CC)/C[N@+]2([C@H]([C@]6(C3=CC=CC=C43)CC2)C1)C |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |
| ID | 1699 |
| Name | C-Curarine |
| Pubchem ID | 5281386 |
| KEGG ID | C09144 |
| Source | Strychnos solimoensana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 596.80 |
| Exact mass | 596.351512 |
| Molecular formula | C40H44N4O+2 |
| XlogP | 3.7 |
| Topological Polar Surface Area | 15.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7=CC=CC=C7C89C61C(=CN(C53O1)C1=CC=CC=C41)C1CC8[N+](CC9)(CC1=CC)C)C |
| Isomeric SMILE | C/C=C/1[C@H]2C3=CN4[C@@]56O[C@]37N(C8=CC=CC=C8[C@]79[C@H](C2)[N@+](C1)(CC9)C)C=C5[C@@H]1/C(=CC)/C[N@+]2([C@H]([C@]6(C3=CC=CC=C43)CC2)C1)C |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |
| ID | 1700 |
| Name | C-Curarine |
| Pubchem ID | 5281386 |
| KEGG ID | C09144 |
| Source | Strychnos usambarensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 596.80 |
| Exact mass | 596.351512 |
| Molecular formula | C40H44N4O+2 |
| XlogP | 3.7 |
| Topological Polar Surface Area | 15.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7=CC=CC=C7C89C61C(=CN(C53O1)C1=CC=CC=C41)C1CC8[N+](CC9)(CC1=CC)C)C |
| Isomeric SMILE | C/C=C/1[C@H]2C3=CN4[C@@]56O[C@]37N(C8=CC=CC=C8[C@]79[C@H](C2)[N@+](C1)(CC9)C)C=C5[C@@H]1/C(=CC)/C[N@+]2([C@H]([C@]6(C3=CC=CC=C43)CC2)C1)C |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2038 |
| Name | Dihydrotoxiferin |
| Pubchem ID | 6444491 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 582.82 |
| Exact mass | 582.372247 |
| Molecular formula | C40H46N4+2 |
| XlogP | 4.3 |
| Topological Polar Surface Area | 6.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 2 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7C(=CN(C53)C8=CC=CC=C48)C9CC1C7(CC[N+]1(CC9=CC)C)C1=CC=CC=C16)C |
| Isomeric SMILE | C/C=C1/C2/C/3=C/N4C5=CC=CC=C5C67C4/C(=CN8C3C9(C3=CC=CC=C83)C(C2)[N+](C1)(CC9)C)/C1/C(=C/C)/C[N+](C6C1)(CC7)C |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2097 |
| Name | Erysonine |
| Pubchem ID | 442218 |
| KEGG ID | C09422 |
| Source | Erythrina caribbean |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 285.34 |
| Exact mass | 285.136493 |
| Molecular formula | C17H19NO3 |
| XlogP | 1.3 |
| Topological Polar Surface Area | 52.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2CCN3CC=C4C3(C2=C1)CC(C=C4)O)O |
| Isomeric SMILE | COC1=C(C=C2CCN3CC=C4[C@]3(C2=C1)C[C@H](C=C4)O)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2098 |
| Name | Erysonine |
| Pubchem ID | 442218 |
| KEGG ID | C09422 |
| Source | Erythrina melanacantha |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 285.34 |
| Exact mass | 285.136493 |
| Molecular formula | C17H19NO3 |
| XlogP | 1.3 |
| Topological Polar Surface Area | 52.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2CCN3CC=C4C3(C2=C1)CC(C=C4)O)O |
| Isomeric SMILE | COC1=C(C=C2CCN3CC=C4[C@]3(C2=C1)C[C@H](C=C4)O)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2099 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina abyssinica |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2100 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina atitlanensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2101 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina crista-galli |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Ito,Chem. Pharm. Bull.,24,(1976),52 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2102 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina flabelliformis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2103 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina goldmanii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2104 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina guatemalensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2105 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina herbacea |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Ahmad,J. Chem. Soc. Perkin Trans. I,(1979),79 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2106 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina lysistemon |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Amer,J. Nat. Prod.,54,(1991),161 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2107 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina macrophylla |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2108 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina oliviae |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2109 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina poeppigiana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Jackson,Allertonia,3,(1982),47 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2110 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina senegalensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2111 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina steyermarkii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2112 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina suberosa |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2113 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina tajumulcensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2114 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina verna |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Sarragiotto,Can. J. Chem.,59,(1981),2771 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2115 |
| Name | Erysotrine |
| Pubchem ID | 442219 |
| KEGG ID | C09423 |
| Source | Erythrina zeyheri |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 30.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2116 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina abyssinica |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2117 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina barqueroana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2118 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina brucei |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Chawla,Phytochem.,24,(1985),1821 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2119 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina burana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2120 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina caribaea |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Chawla,Phytochem.,24,(1985),1821 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2121 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina caribbean |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2122 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina chiapasana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Barakat,Lloydia,40,(1977),471 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2123 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina cochleata |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Chawla,Phytochem.,24,(1985),1821 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2124 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina coralloides |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2125 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina decora |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Barakat,Lloydia,40,(1977),471 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2126 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina eggersii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Barakat,Lloydia,40,(1977),471 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2127 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina excelsa |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2128 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina falcata |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Deulofeu,Chem. Ber.,85,(1952),620 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2129 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina goldmanii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2130 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina guatemalensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2131 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina latissima |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2132 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina livingstoniana |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2133 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina macrophylla |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Jackson,Allertonia,3,(1982),47 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2134 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina melanacantha |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2135 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina oliviae |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2136 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina orophila |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Barakat,Lloydia,40,(1977),471 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2137 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina perrieri |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2138 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina rubrinervia |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Jackson,Allertonia,3,(1982),47 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2139 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina senegalensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2140 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina sigmoidea |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2141 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina steyermarkii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2142 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina suberosa |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Chawla,J.Pharm.Sci.,51,(1989),189 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2143 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina tahitensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Games,Lloydia,37,(1974),581 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2306 |
| Name | Isococculidine |
| Pubchem ID | 442300 |
| KEGG ID | C09546 |
| Source | Cocculus laurifolius |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 285.38 |
| Exact mass | 285.172879 |
| Molecular formula | C18H23NO2 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 21.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(CCN2CCC4=C3C=C(C=C4)OC)C=C1 |
| Isomeric SMILE | CO[C@@H]1C[C@@]23[C@H](CCN2CCC4=C3C=C(C=C4)OC)C=C1 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2493 |
| Name | Laudanosine |
| Pubchem ID | 15548 |
| KEGG ID | N/A |
| Source | Polyalthia cerasoides |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 357.44 |
| Exact mass | 357.194008 |
| Molecular formula | C21H27NO4 |
| XlogP | 3.7 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 6 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2686 |
| Name | Metocurine |
| Pubchem ID | 24244 |
| KEGG ID | D00761 |
| Source | Cyclea hainanensis |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 906.63 |
| Exact mass | 906.160173 |
| Molecular formula | C40H48I2N2O6 |
| XlogP | N/A |
| Topological Polar Surface Area | 55.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)OC)O3)[N+](CCC6=CC(=C5OC)OC)(C)C)OC)C.[I-].[I-] |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC(=C(C=C7)OC)O3)[N+](CCC6=CC(=C5OC)OC)(C)C)OC)C.[I-].[I-] |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2693 |
| Name | Mivacurium |
| Pubchem ID | 6308454 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 1029.26 |
| Exact mass | 1028.560955 |
| Molecular formula | C58H80N2O14+2 |
| XlogP | 8.7 |
| Topological Polar Surface Area | 145 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 14 |
| Rotational Bond Count | 30 |
| IUPAC Name | bis[3-[6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] (E)-oct-4-enedioate |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3)OC)OC)OC)OC)OC)CCCOC(=O)CCC=CCCC(=O)OCCC[N+]4(CCC5=CC(=C(C=C5C4CC6=CC(=C(C(=C6)OC)OC)OC)OC)OC)C |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3)OC)OC)OC)OC)OC)CCCOC(=O)CC/C=C/CCC(=O)OCCC[N+]4(CCC5=CC(=C(C=C5C4CC6=CC(=C(C(=C6)OC)OC)OC)OC)OC)C |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2798 |
| Name | Norcoralydine |
| Pubchem ID | 10653 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 355.43 |
| Exact mass | 355.178358 |
| Molecular formula | C21H25NO4 |
| XlogP | 3.2 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | 2,3,10,11-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2C3CC4=CC(=C(C=C4CN3CCC2=C1)OC)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3435 |
| Name | Toxiferine |
| Pubchem ID | 5281411 |
| KEGG ID | C09246 |
| Source | Strychnos froesii |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 614.82 |
| Exact mass | 614.362077 |
| Molecular formula | C40H46N4O2+2 |
| XlogP | 1.8 |
| Topological Polar Surface Area | 46.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]12CCC34C1CC(C(=CCO)C2)C5=CN6C7C(=CN(C53)C8=CC=CC=C48)C9CC1C7(CC[N+]1(CC9=CCO)C)C1=CC=CC=C16 |
| Isomeric SMILE | C[N@@+]12[C@@H]3[C@]4(C5=CC=CC=C5N/6[C@H]4/C(=CN7[C@H]8/C(=C6)/[C@@H]9/C(=CCO)/C[N@+]4([C@H]([C@]8(C5=CC=CC=C75)CC4)C9)C)/[C@@H](C3)/C(=CCO)/C1)CC2 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |
| ID | 3436 |
| Name | Toxiferine |
| Pubchem ID | 5281411 |
| KEGG ID | C09246 |
| Source | Strychnos toxifera |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 614.82 |
| Exact mass | 614.362077 |
| Molecular formula | C40H46N4O2+2 |
| XlogP | 1.8 |
| Topological Polar Surface Area | 46.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]12CCC34C1CC(C(=CCO)C2)C5=CN6C7C(=CN(C53)C8=CC=CC=C48)C9CC1C7(CC[N+]1(CC9=CCO)C)C1=CC=CC=C16 |
| Isomeric SMILE | C[N@@+]12[C@@H]3[C@]4(C5=CC=CC=C5N/6[C@H]4/C(=CN7[C@H]8/C(=C6)/[C@@H]9/C(=CCO)/C[N@+]4([C@H]([C@]8(C5=CC=CC=C75)CC4)C9)C)/[C@@H](C3)/C(=CCO)/C1)CC2 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |
| ID | 3437 |
| Name | Toxiferine I |
| Pubchem ID | 5321990 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 630.86 |
| Exact mass | 630.393377 |
| Molecular formula | C41H50N4O2+2 |
| XlogP | N/A |
| Topological Polar Surface Area | 46.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | [HH].CC12CC3C(=CCO)C[N+]1(CCC24C5C3=CN6C7C(=CN5C8=CC=CC=C48)C9CC1C7(CC[N+]1(CC9=CCO)C)C1=CC=CC=C16)C |
| Isomeric SMILE | [HH].C[C@@]12C[C@H]3/C(=CCO)/C[N@@+]1(CC[C@]24[C@@H]5/C3=CN6[C@H]7/C(=CN5C8=CC=CC=C48)/[C@H]9C[C@H]1[C@@]7(CC[N@+]1(C/C9=C/CO)C)C1=CC=CC=C16)C |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3452 |
| Name | Tubocurarine |
| Pubchem ID | 5351750 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 660.22 |
| Exact mass | 659.28879 |
| Molecular formula | C38H44ClN2O6+ |
| XlogP | N/A |
| Topological Polar Surface Area | 77.4 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC)C.[Cl-] |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC)C.[Cl-] |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3453 |
| Name | Tubocurarine |
| Pubchem ID | 6000 |
| KEGG ID | C07547 |
| Source | Chondrodendron tomentosum |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 609.73 |
| Exact mass | 609.296462 |
| Molecular formula | C37H41N2O6+ |
| XlogP | 6 |
| Topological Polar Surface Area | 80.6 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3454 |
| Name | Tubocurarine |
| Pubchem ID | 64645 |
| KEGG ID | N/A |
| Source | Menispermaceae |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 681.65 |
| Exact mass | 680.241993 |
| Molecular formula | C37H42Cl2N2O6 |
| XlogP | N/A |
| Topological Polar Surface Area | 81.8 |
| H-Bond Donor | 3 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[NH+]1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC.[Cl-].[Cl-] |
| Isomeric SMILE | C[NH+]1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC.[Cl-].[Cl-] |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |