ID | 1177 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Annona cherimolia |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1178 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Annona reticulata |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 1179 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Annona senegalensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. You,J.Nat.Prod.,58,(1995),598 2. Philipov,Fitoterapia,66,(1995),275 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
ID | 1180 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Nelumbo nucifera |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 1181 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Rollinia mucosa |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Chen,J.Nat.Prod.,59,(1996),904 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 1182 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Stephania cepharantha |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Kashiwaba,Chem.Pharm.Bull.,45,(1997),470 2. Kashiwaba,Chem.Pharm.Bull.,43,(1997),545 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
ID | 1183 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Xylopia papus |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Bermejo,Nat.Prod.Lett.,6,(1995),57 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 1184 |
Name | Anonaine |
Pubchem ID | 160597 |
KEGG ID | C09339 |
Source | Xylopia parviflora |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 265.31 |
Exact mass | 265.110279 |
Molecular formula | C17H15NO2 |
XlogP | 2.8 |
Topological Polar Surface Area | 30.5 |
H-Bond Donor | 1 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 1659 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Camellia kissi |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1660 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Camellia sinensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1661 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Camellia taliensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1662 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Citrus maxima |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1663 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea arabica |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1664 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea canephora |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1665 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea dewevrei |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1666 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea eugenioides |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1667 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea kianjavatensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1668 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea liberica |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1669 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea racemosa |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1670 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Coffea salvatrix |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1671 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Cola acuminata |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1672 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Ilex paraguayensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1673 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Paullinia cupana |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1674 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Scurrula atropurpurea |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1675 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Spodoptera litura |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1676 |
Name | Caffeine |
Pubchem ID | 2519 |
KEGG ID | D00528 |
Source | Theobroma cacao |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 194.19 |
Exact mass | 194.080376 |
Molecular formula | C8H10N4O2 |
XlogP | -0.1 |
Topological Polar Surface Area | 58.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2148 |
Name | Ethaverine |
Pubchem ID | 13796 |
KEGG ID | N/A |
Source | N/A |
Type | Unknown |
Function | Smooth muscle relaxant |
Drug Like Properties | No |
Molecular Weight | 431.95 |
Exact mass | 431.186336 |
Molecular formula | C24H30ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 51.1 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 10 |
IUPAC Name | 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinolin-2-ium chloride |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCOC1=C(C=C(C=C1)CC2=[NH+]C=CC3=CC(=C(C=C32)OCC)OCC)OCC.[Cl-] |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2402 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Corydalis cava |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Ribar,Bull.Acad.Serbe Sci.Arts.Cl.Sci.Math.Nat.Sci.Nat.,40,(2003),95 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2403 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Corydalis esquirolii |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Li,Zhongcayao,22,(1991),486 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2404 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Corydalis omeiensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Xia,Zhongguo Yaoxue Zazhi,25,(1990),716 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2405 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Corydalis ophiocarpa |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2406 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Corydalis yanhusuo |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Xu,Zhongguo Yaoke Daxue Xuebao,33,(2002),483 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2407 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Enantia chlorantha |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Samir,Bull.Fac.Sci.Assiut.Univ.,18,(1989),21 2. Jalander,Collect.Czech.Chem.Commun.,55,(1990),2095 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
ID | 2408 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Hydrastis canadensis |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2409 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Papaver triniifolium |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Sari,Pharmazie,55,(2000),471 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2410 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Stephania mashanica |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2411 |
Name | Isocorypalmine |
Pubchem ID | 440229 |
KEGG ID | C04118 |
Source | Zanthoxylum taediosum |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
Drugpedia | wiki |
References | 1. Laguna,CENIC.Cienc.Quim.,30,(1999),92 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2807 |
Name | Norstephalagine |
Pubchem ID | 133381 |
KEGG ID | N/A |
Source | Artabotrys maingayi |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 295.33 |
Exact mass | 295.120843 |
Molecular formula | C18H17NO3 |
XlogP | 2.8 |
Topological Polar Surface Area | 39.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C2CCNC3C2=C(C4=CC=CC=C4C3)C5=C1OCO5 |
Isomeric SMILE | COC1=C2CCN[C@H]3C2=C(C4=CC=CC=C4C3)C5=C1OCO5 |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 2898 |
Name | Papaverine |
Pubchem ID | 4680 |
KEGG ID | C06533 |
Source | Papaver somniferum |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 339.39 |
Exact mass | 339.147058 |
Molecular formula | C20H21NO4 |
XlogP | 3.9 |
Topological Polar Surface Area | 49.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 6 |
IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2899 |
Name | Papaverine |
Pubchem ID | 4680 |
KEGG ID | C06533 |
Source | Rauvolfia serpentina |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | Yes |
Molecular Weight | 339.39 |
Exact mass | 339.147058 |
Molecular formula | C20H21NO4 |
XlogP | 3.9 |
Topological Polar Surface Area | 49.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 6 |
IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2904 |
Name | Papaverine |
Pubchem ID | 6084 |
KEGG ID | D02218 |
Source | Papaver somniferum |
Type | Natural |
Function | Smooth muscle relaxant |
Drug Like Properties | No |
Molecular Weight | 375.85 |
Exact mass | 375.123736 |
Molecular formula | C20H22ClNO4 |
XlogP | N/A |
Topological Polar Surface Area | 49.8 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 6 |
IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline hydrochloride |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |