| ID | 1177 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Annona cherimolia |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1178 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Annona reticulata |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1179 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Annona senegalensis |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. You,J.Nat.Prod.,58,(1995),598 2. Philipov,Fitoterapia,66,(1995),275 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 1180 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1181 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Rollinia mucosa |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Chen,J.Nat.Prod.,59,(1996),904 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1182 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Stephania cepharantha |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Kashiwaba,Chem.Pharm.Bull.,45,(1997),470 2. Kashiwaba,Chem.Pharm.Bull.,43,(1997),545 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 1183 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Xylopia papus |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Bermejo,Nat.Prod.Lett.,6,(1995),57 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1184 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1659 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Camellia kissi |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1660 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Camellia sinensis |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1661 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Camellia taliensis |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1662 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Citrus maxima |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1663 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea arabica |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1664 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea canephora |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1665 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea dewevrei |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1666 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea eugenioides |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1667 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea kianjavatensis |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1668 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea liberica |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1669 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea racemosa |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1670 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Coffea salvatrix |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1671 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Cola acuminata |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1672 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Ilex paraguayensis |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1673 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Paullinia cupana |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1674 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Scurrula atropurpurea |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1675 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Spodoptera litura |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1676 |
| Name | Caffeine |
| Pubchem ID | 2519 |
| KEGG ID | D00528 |
| Source | Theobroma cacao |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 194.19 |
| Exact mass | 194.080376 |
| Molecular formula | C8H10N4O2 |
| XlogP | -0.1 |
| Topological Polar Surface Area | 58.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | 1,3,7-trimethylpurine-2,6-dione |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C=NC2=C1C(=O)N(C(=O)N2C)C |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2148 |
| Name | Ethaverine |
| Pubchem ID | 13796 |
| KEGG ID | N/A |
| Source | N/A |
| Type | Unknown |
| Function | Smooth muscle relaxant |
| Drug Like Properties | No |
| Molecular Weight | 431.95 |
| Exact mass | 431.186336 |
| Molecular formula | C24H30ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 51.1 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 10 |
| IUPAC Name | 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinolin-2-ium chloride |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CCOC1=C(C=C(C=C1)CC2=[NH+]C=CC3=CC(=C(C=C32)OCC)OCC)OCC.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2402 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Corydalis cava |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Ribar,Bull.Acad.Serbe Sci.Arts.Cl.Sci.Math.Nat.Sci.Nat.,40,(2003),95 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2403 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Corydalis esquirolii |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Li,Zhongcayao,22,(1991),486 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2404 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Corydalis omeiensis |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Xia,Zhongguo Yaoxue Zazhi,25,(1990),716 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2405 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Corydalis ophiocarpa |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2406 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Corydalis yanhusuo |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Xu,Zhongguo Yaoke Daxue Xuebao,33,(2002),483 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2407 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Enantia chlorantha |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Samir,Bull.Fac.Sci.Assiut.Univ.,18,(1989),21 2. Jalander,Collect.Czech.Chem.Commun.,55,(1990),2095 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 2408 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Hydrastis canadensis |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2409 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Papaver triniifolium |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Sari,Pharmazie,55,(2000),471 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2410 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Stephania mashanica |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2411 |
| Name | Isocorypalmine |
| Pubchem ID | 440229 |
| KEGG ID | C04118 |
| Source | Zanthoxylum taediosum |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (13aS)-3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Isomeric SMILE | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
| Drugpedia | wiki |
| References | 1. Laguna,CENIC.Cienc.Quim.,30,(1999),92 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2807 |
| Name | Norstephalagine |
| Pubchem ID | 133381 |
| KEGG ID | N/A |
| Source | Artabotrys maingayi |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 295.33 |
| Exact mass | 295.120843 |
| Molecular formula | C18H17NO3 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 39.7 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C2CCNC3C2=C(C4=CC=CC=C4C3)C5=C1OCO5 |
| Isomeric SMILE | COC1=C2CCN[C@H]3C2=C(C4=CC=CC=C4C3)C5=C1OCO5 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2898 |
| Name | Papaverine |
| Pubchem ID | 4680 |
| KEGG ID | C06533 |
| Source | Papaver somniferum |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.9 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 6 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2899 |
| Name | Papaverine |
| Pubchem ID | 4680 |
| KEGG ID | C06533 |
| Source | Rauvolfia serpentina |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.9 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 6 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2904 |
| Name | Papaverine |
| Pubchem ID | 6084 |
| KEGG ID | D02218 |
| Source | Papaver somniferum |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | No |
| Molecular Weight | 375.85 |
| Exact mass | 375.123736 |
| Molecular formula | C20H22ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 6 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline hydrochloride |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |