ID | 2274 |
Name | Higenamine |
Pubchem ID | 440988 |
KEGG ID | C06347 |
Source | Aconitum japonicum |
Type | Natural |
Function | Cardiac stimulant |
Drug Like Properties | Yes |
Molecular Weight | 271.31 |
Exact mass | 271.120843 |
Molecular formula | C16H17NO3 |
XlogP | 2.2 |
Topological Polar Surface Area | 72.7 |
H-Bond Donor | 4 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | (1R)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
Isomeric SMILE | C1CN[C@@H](C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2275 |
Name | Higenamine |
Pubchem ID | 440988 |
KEGG ID | C06347 |
Source | Aconitum japonicum |
Type | Natural |
Function | Thromboxane A(2) antagonist |
Drug Like Properties | Yes |
Molecular Weight | 271.31 |
Exact mass | 271.120843 |
Molecular formula | C16H17NO3 |
XlogP | 2.2 |
Topological Polar Surface Area | 72.7 |
H-Bond Donor | 4 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | (1R)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
Isomeric SMILE | C1CN[C@@H](C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |