| ID | 2274 |
| Name | Higenamine |
| Pubchem ID | 440988 |
| KEGG ID | C06347 |
| Source | Aconitum japonicum |
| Type | Natural |
| Function | Cardiac stimulant |
| Drug Like Properties | Yes |
| Molecular Weight | 271.31 |
| Exact mass | 271.120843 |
| Molecular formula | C16H17NO3 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 72.7 |
| H-Bond Donor | 4 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | (1R)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
| Isomeric SMILE | C1CN[C@@H](C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2275 |
| Name | Higenamine |
| Pubchem ID | 440988 |
| KEGG ID | C06347 |
| Source | Aconitum japonicum |
| Type | Natural |
| Function | Thromboxane A(2) antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 271.31 |
| Exact mass | 271.120843 |
| Molecular formula | C16H17NO3 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 72.7 |
| H-Bond Donor | 4 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | (1R)-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
| Isomeric SMILE | C1CN[C@@H](C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |