ID | 1105 |
Name | Alangiside |
Pubchem ID | 442161 |
KEGG ID | C09330 |
Source | Alangium longiflorum |
Type | Natural |
Function | Anthelmintic |
Drug Like Properties | No |
Molecular Weight | 505.51 |
Exact mass | 505.194796 |
Molecular formula | C25H31NO10 |
XlogP | -0.1 |
Topological Polar Surface Area | 158 |
H-Bond Donor | 5 |
H-Bond Acceptor | 10 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C=C2C3CC4C(C(OC=C4C(=O)N3CCC2=C1)OC5C(C(C(C(O5)CO)O)O)O)C=C)O |
Isomeric SMILE | COC1=C(C=C2[C@H]3C[C@H]4[C@H]([C@@H](OC=C4C(=O)N3CCC2=C1)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C=C)O |
Drugpedia | wiki |
References | 1. Source 2. Function 3. All Records |
ID | 1702 |
Name | Cephaelin |
Pubchem ID | 442195 |
KEGG ID | C09390 |
Source | Alangium longiflorum |
Type | Natural |
Function | Anti-amoebic |
Drug Like Properties | Yes |
Molecular Weight | 466.61 |
Exact mass | 466.283158 |
Molecular formula | C28H38N2O4 |
XlogP | 4.4 |
Topological Polar Surface Area | 63.2 |
H-Bond Donor | 2 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 6 |
IUPAC Name | (1R)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinolin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 1717 |
Name | Cephaelin |
Pubchem ID | 442195 |
KEGG ID | C09390 |
Source | Alangium longiflorum |
Type | Natural |
Function | Protein synthesis inhibitor |
Drug Like Properties | Yes |
Molecular Weight | 466.61 |
Exact mass | 466.283158 |
Molecular formula | C28H38N2O4 |
XlogP | 4.4 |
Topological Polar Surface Area | 63.2 |
H-Bond Donor | 2 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 6 |
IUPAC Name | (1R)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinolin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2068 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Alangium longiflorum |
Type | Natural |
Function | Antiprotozoal |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2073 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Alangium longiflorum |
Type | Natural |
Function | Antiparasitic |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2078 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Alangium longiflorum |
Type | Natural |
Function | Protein synthesis inhibitor |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2083 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Alangium longiflorum |
Type | Natural |
Function | Anticancer |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2088 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Alangium longiflorum |
Type | Natural |
Function | Cytotoxic |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2093 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Alangium longiflorum |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Sakurai,Phytochem.,67,(2006),894 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |