| ID | 1982 |
| Name | Daphnandrine |
| Pubchem ID | 442214 |
| KEGG ID | C09415 |
| Source | Anisocycla cymosa |
| Type | Natural |
| Function | Antiprotozoal |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 5.9 |
| Topological Polar Surface Area | 81.7 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=CC(=C(C=C7CCN6)OC)O3)OC)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@@H]6C7=CC(=C(C=C7CCN6)OC)O3)OC)O)OC |
| Drugpedia | wiki |
| References | 1. Kanyinda,J.Nat.Prod.,56,(1993),618 2. Kanyinda,J.Nat.Prod.,56,(1993),957 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 3443 |
| Name | Trilobine |
| Pubchem ID | 169007 |
| KEGG ID | C09669 |
| Source | Anisocycla cymosa |
| Type | Natural |
| Function | Antiplatelet |
| Drug Like Properties | No |
| Molecular Weight | 562.65 |
| Exact mass | 562.246772 |
| Molecular formula | C35H34N2O5 |
| XlogP | 5.9 |
| Topological Polar Surface Area | 61.4 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C4C=C2C1CC5=CC(=C(C=C5)OC)OC6=CC=C(CC7C8=C(O4)C(=C(C=C8CCN7)OC)O3)C=C6 |
| Isomeric SMILE | CN1CCC2=CC3=C4C=C2[C@@H]1CC5=CC(=C(C=C5)OC)OC6=CC=C(C[C@H]7C8=C(O4)C(=C(C=C8CCN7)OC)O3)C=C6 |
| Drugpedia | wiki |
| References | 1. Kanyinda,Planta Med.,55,(1989),394 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |