ID | 1161 |
Name | Anolobine |
Pubchem ID | 164710 |
KEGG ID | C09338 |
Source | Annona cherimola |
Type | Natural |
Function | Antimicrobial |
Drug Like Properties | Yes |
Molecular Weight | 281.31 |
Exact mass | 281.105193 |
Molecular formula | C17H15NO3 |
XlogP | 2.5 |
Topological Polar Surface Area | 50.7 |
H-Bond Donor | 2 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1CNC2CC3=C(C=CC(=C3)O)C4=C2C1=CC5=C4OCO5 |
Isomeric SMILE | C1CN[C@@H]2CC3=C(C=CC(=C3)O)C4=C2C1=CC5=C4OCO5 |
Drugpedia | wiki |
References | 1. Chen,J.Chin.Chem.Soc.(Taipei),48,(2001),1203 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2308 |
Name | Isocorydine |
Pubchem ID | 10143 |
KEGG ID | C09549 |
Source | Annona cherimola |
Type | Natural |
Function | Calcium channel blocker |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.6 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
Drugpedia | wiki |
References | 1. Chen,J.Clin.Chem.Soc.(Taipei),44,(1997),313 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2355 |
Name | Isocorydine |
Pubchem ID | 10143 |
KEGG ID | C09549 |
Source | Annona cherimola |
Type | Natural |
Function | Sedative |
Drug Like Properties | Yes |
Molecular Weight | 341.40 |
Exact mass | 341.162708 |
Molecular formula | C20H23NO4 |
XlogP | 2.6 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
Drugpedia | wiki |
References | 1. Chen,J.Clin.Chem.Soc.(Taipei),44,(1997),313 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2508 |
Name | Liriodenine |
Pubchem ID | 10144 |
KEGG ID | C09567 |
Source | Annona cherimola |
Type | Natural |
Function | Antifungal |
Drug Like Properties | Yes |
Molecular Weight | 275.26 |
Exact mass | 275.058243 |
Molecular formula | C17H9NO3 |
XlogP | 3.4 |
Topological Polar Surface Area | 48.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Chen,J.Chin.Chem.Soc.(Taipei),48,(2001),1203 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2953 |
Name | Pronuciferine |
Pubchem ID | 200480 |
KEGG ID | C09611 |
Source | Annona cherimola |
Type | Natural |
Function | Anaesthetic |
Drug Like Properties | Yes |
Molecular Weight | 311.37 |
Exact mass | 311.152144 |
Molecular formula | C19H21NO3 |
XlogP | 2.5 |
Topological Polar Surface Area | 38.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
Drugpedia | wiki |
References | 1. Chen,J.Chin.Chem.Soc.(Taipei),46,(1999),77 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3043 |
Name | Reticuline |
Pubchem ID | 10233 |
KEGG ID | C12328 |
Source | Annona cherimola |
Type | Natural |
Function | Dopamine Antagonist |
Drug Like Properties | Yes |
Molecular Weight | 329.39 |
Exact mass | 329.162708 |
Molecular formula | C19H23NO4 |
XlogP | 3 |
Topological Polar Surface Area | 62.2 |
H-Bond Donor | 2 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 4 |
IUPAC Name | 1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)O)O)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Yang,Zhongguo Yaoxue Zazhi,43,(1991),457 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3462 |
Name | Xylopine |
Pubchem ID | 160503 |
KEGG ID | C09670 |
Source | Annona cherimola |
Type | Natural |
Function | Analgesic |
Drug Like Properties | Yes |
Molecular Weight | 295.33 |
Exact mass | 295.120843 |
Molecular formula | C18H17NO3 |
XlogP | 2.8 |
Topological Polar Surface Area | 39.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
Drugpedia | wiki |
References | 1. Chen,J.Chin.Chem.Soc.(Taipei),48,(2001),1203 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3474 |
Name | Xylopine |
Pubchem ID | 160503 |
KEGG ID | C09670 |
Source | Annona cherimola |
Type | Natural |
Function | Leishmanicidal |
Drug Like Properties | Yes |
Molecular Weight | 295.33 |
Exact mass | 295.120843 |
Molecular formula | C18H17NO3 |
XlogP | 2.8 |
Topological Polar Surface Area | 39.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
Drugpedia | wiki |
References | 1. Chen,J.Chin.Chem.Soc.(Taipei),48,(2001),1203 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3486 |
Name | Xylopine |
Pubchem ID | 160503 |
KEGG ID | C09670 |
Source | Annona cherimola |
Type | Natural |
Function | Antiplatelet |
Drug Like Properties | Yes |
Molecular Weight | 295.33 |
Exact mass | 295.120843 |
Molecular formula | C18H17NO3 |
XlogP | 2.8 |
Topological Polar Surface Area | 39.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
Drugpedia | wiki |
References | 1. Chen,J.Chin.Chem.Soc.(Taipei),48,(2001),1203 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |