ID | 1621 |
Name | Bulbocapnine |
Pubchem ID | 12441 |
KEGG ID | C09367 |
Source | Antizoma angustifolia |
Type | Natural |
Function | Dopamine Antagonist |
Drug Like Properties | Yes |
Molecular Weight | 325.36 |
Exact mass | 325.131408 |
Molecular formula | C19H19NO4 |
XlogP | 2.9 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC3=C(C4=C2C1CC5=C4C(=C(C=C5)OC)O)OCO3 |
Isomeric SMILE | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=C4C(=C(C=C5)OC)O)OCO3 |
Drugpedia | wiki |
References | 1. De Wet,Biochem.Syst.Ecol.,32,(2004),1145 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2248 |
Name | Glaziovine |
Pubchem ID | 442245 |
KEGG ID | C09457 |
Source | Antizoma angustifolia |
Type | Natural |
Function | Antidepressant |
Drug Like Properties | Yes |
Molecular Weight | 297.35 |
Exact mass | 297.136493 |
Molecular formula | C18H19NO3 |
XlogP | 2.2 |
Topological Polar Surface Area | 49.8 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)O)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)O)OC |
Drugpedia | wiki |
References | 1. De Wet,Biochem.Syst.Ecol.,32,(2004),1145 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2955 |
Name | Pronuciferine |
Pubchem ID | 200480 |
KEGG ID | C09611 |
Source | Antizoma angustifolia |
Type | Natural |
Function | Anaesthetic |
Drug Like Properties | Yes |
Molecular Weight | 311.37 |
Exact mass | 311.152144 |
Molecular formula | C19H21NO3 |
XlogP | 2.5 |
Topological Polar Surface Area | 38.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
Drugpedia | wiki |
References | 1. De Wet,Biochem.Syst.Ecol.,32,(2004),1145 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3117 |
Name | Salutaridine |
Pubchem ID | 5408233 |
KEGG ID | C05179 |
Source | Antizoma angustifolia |
Type | Natural |
Function | Anticancer |
Drug Like Properties | Yes |
Molecular Weight | 327.37 |
Exact mass | 327.147058 |
Molecular formula | C19H21NO4 |
XlogP | 1.9 |
Topological Polar Surface Area | 59 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 2 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC23C=C(C(=O)C=C2C1CC4=C3C(=C(C=C4)OC)O)OC |
Isomeric SMILE | CN1CC[C@]23C=C(C(=O)C=C2[C@H]1CC4=C3C(=C(C=C4)OC)O)OC |
Drugpedia | wiki |
References | 1. De Wet,Biochem.Syst.Ecol.,32,(2004),1145 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |