| ID | 1203 |
| Name | (-)-Argemonine |
| Pubchem ID | 442168 |
| KEGG ID | C09341 |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Antiarrhythmic |
| Drug Like Properties | Yes |
| Molecular Weight | 355.43 |
| Exact mass | 355.178358 |
| Molecular formula | C21H25NO4 |
| XlogP | 3.3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C2CC3=CC(=C(C=C3C1CC4=CC(=C(C=C24)OC)OC)OC)OC |
| Isomeric SMILE | CN1[C@H]2CC3=CC(=C(C=C3[C@@H]1CC4=CC(=C(C=C24)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2973 |
| Name | Protopine |
| Pubchem ID | 4970 |
| KEGG ID | C05189 |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | Yes |
| Molecular Weight | 353.37 |
| Exact mass | 353.126323 |
| Molecular formula | C20H19NO5 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 57.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3186 |
| Name | Sanguinarine |
| Pubchem ID | 68635 |
| KEGG ID | D05799 |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Glutamate decarboxylase inhibitor |
| Drug Like Properties | No |
| Molecular Weight | 367.78 |
| Exact mass | 367.061136 |
| Molecular formula | C20H14ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3188 |
| Name | Sanguinarine |
| Pubchem ID | 68635 |
| KEGG ID | D05799 |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | No |
| Molecular Weight | 367.78 |
| Exact mass | 367.061136 |
| Molecular formula | C20H14ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3190 |
| Name | Sanguinarine |
| Pubchem ID | 68635 |
| KEGG ID | D05799 |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | No |
| Molecular Weight | 367.78 |
| Exact mass | 367.061136 |
| Molecular formula | C20H14ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3192 |
| Name | Sanguinarine |
| Pubchem ID | 68635 |
| KEGG ID | D05799 |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Anti-inflammatory |
| Drug Like Properties | No |
| Molecular Weight | 367.78 |
| Exact mass | 367.061136 |
| Molecular formula | C20H14ClNO4 |
| XlogP | N/A |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[Cl-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3194 |
| Name | Sanguinarine |
| Pubchem ID | 72619 |
| KEGG ID | N/A |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Glutamate decarboxylase inhibitor |
| Drug Like Properties | No |
| Molecular Weight | 394.33 |
| Exact mass | 394.080101 |
| Molecular formula | C20H14N2O7 |
| XlogP | N/A |
| Topological Polar Surface Area | 107 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[N+](=O)([O-])[O-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3196 |
| Name | Sanguinarine |
| Pubchem ID | 72619 |
| KEGG ID | N/A |
| Source | Argemone mexicana |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | No |
| Molecular Weight | 394.33 |
| Exact mass | 394.080101 |
| Molecular formula | C20H14N2O7 |
| XlogP | N/A |
| Topological Polar Surface Area | 107 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6.[N+](=O)([O-])[O-] |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |