| ID | 1080 |
| Name | Actinodaphine |
| Pubchem ID | 160502 |
| KEGG ID | C09322 |
| Source | Cassytha filiformis |
| Type | Natural |
| Function | Antimicrobial |
| Drug Like Properties | Yes |
| Molecular Weight | 311.33 |
| Exact mass | 311.115758 |
| Molecular formula | C18H17NO4 |
| XlogP | 2.4 |
| Topological Polar Surface Area | 60 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2CC3C4=C(C2=C1)C5=C(C=C4CCN3)OCO5)O |
| Isomeric SMILE | COC1=C(C=C2C[C@H]3C4=C(C2=C1)C5=C(C=C4CCN3)OCO5)O |
| Drugpedia | wiki |
| References | 1. Wu,Phytother.Res.,12,(1998),1 2. Chao,Phytochem.,46,(1997),181 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 2019 |
| Name | Dicentrine |
| Pubchem ID | 101300 |
| KEGG ID | N/A |
| Source | Cassytha filiformis |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.2 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C2C1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2020 |
| Name | Dicentrine |
| Pubchem ID | 101300 |
| KEGG ID | N/A |
| Source | Cassytha filiformis |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.2 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C2C1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2021 |
| Name | Dicentrine |
| Pubchem ID | 101300 |
| KEGG ID | N/A |
| Source | Cassytha filiformis |
| Type | Natural |
| Function | Anticancer |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.2 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C2C1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2421 |
| Name | Isoteolin |
| Pubchem ID | 133323 |
| KEGG ID | C09541 |
| Source | Cassytha filiformis |
| Type | Natural |
| Function | Insect feeding inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 327.37 |
| Exact mass | 327.147058 |
| Molecular formula | C19H21NO4 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 62.2 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)O)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)O)O)OC |
| Drugpedia | wiki |
| References | 1. Chao,Phytochem.,46,(1997),181 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2853 |
| Name | Ocoteine |
| Pubchem ID | 52499 |
| KEGG ID | N/A |
| Source | Cassytha filiformis |
| Type | Natural |
| Function | Adrenergic alpha-blocker |
| Drug Like Properties | Yes |
| Molecular Weight | 369.41 |
| Exact mass | 369.157623 |
| Molecular formula | C21H23NO5 |
| XlogP | 3.2 |
| Topological Polar Surface Area | 49.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=C(C3=C(C4=C2C1CC5=CC(=C(C=C54)OC)OC)OCO3)OC |
| Isomeric SMILE | CN1CCC2=C(C3=C(C4=C2[C@@H]1CC5=CC(=C(C=C54)OC)OC)OCO3)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |