| ID | 1262 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Chondrodendron tomentosum |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3453 |
| Name | Tubocurarine |
| Pubchem ID | 6000 |
| KEGG ID | C07547 |
| Source | Chondrodendron tomentosum |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | No |
| Molecular Weight | 609.73 |
| Exact mass | 609.296462 |
| Molecular formula | C37H41N2O6+ |
| XlogP | 6 |
| Topological Polar Surface Area | 80.6 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |