| ID | 1263 |
| Name | Bebeerine |
| Pubchem ID | 12300019 |
| KEGG ID | C09352 |
| Source | Cissampelos pareira |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | No |
| Molecular Weight | 594.70 |
| Exact mass | 594.272987 |
| Molecular formula | C36H38N2O6 |
| XlogP | 6 |
| Topological Polar Surface Area | 83.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1622 |
| Name | Bulbocapnine |
| Pubchem ID | 12441 |
| KEGG ID | C09367 |
| Source | Cissampelos pareira |
| Type | Natural |
| Function | Dopamine Antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 325.36 |
| Exact mass | 325.131408 |
| Molecular formula | C19H19NO4 |
| XlogP | 2.9 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C4=C2C1CC5=C4C(=C(C=C5)OC)O)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=C4C(=C(C=C5)OC)O)OCO3 |
| Drugpedia | wiki |
| References | 1. Ahmad,Fitoterapia,63,(1992),287 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2589 |
| Name | Magnoflorine |
| Pubchem ID | 73337 |
| KEGG ID | C09581 |
| Source | Cissampelos pareira |
| Type | Natural |
| Function | Hypotensive |
| Drug Like Properties | Yes |
| Molecular Weight | 342.41 |
| Exact mass | 342.170533 |
| Molecular formula | C20H24NO4+ |
| XlogP | 2.7 |
| Topological Polar Surface Area | 58.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Drugpedia | wiki |
| References | 1. Ahmad,Fitoterapia,63,(1992),287 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2637 |
| Name | Magnoflorine |
| Pubchem ID | 73337 |
| KEGG ID | C09581 |
| Source | Cissampelos pareira |
| Type | Natural |
| Function | Antioxidant |
| Drug Like Properties | Yes |
| Molecular Weight | 342.41 |
| Exact mass | 342.170533 |
| Molecular formula | C20H24NO4+ |
| XlogP | 2.7 |
| Topological Polar Surface Area | 58.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Drugpedia | wiki |
| References | 1. Ahmad,Fitoterapia,63,(1992),287 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3360 |
| Name | Tetrandrine |
| Pubchem ID | 73078 |
| KEGG ID | C09654 |
| Source | Cissampelos pareira |
| Type | Natural |
| Function | Anti-inflammatory |
| Drug Like Properties | No |
| Molecular Weight | 622.75 |
| Exact mass | 622.304287 |
| Molecular formula | C38H42N2O6 |
| XlogP | 6.4 |
| Topological Polar Surface Area | 61.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3368 |
| Name | Tetrandrine |
| Pubchem ID | 73078 |
| KEGG ID | C09654 |
| Source | Cissampelos pareira |
| Type | Natural |
| Function | Antifibrotic |
| Drug Like Properties | No |
| Molecular Weight | 622.75 |
| Exact mass | 622.304287 |
| Molecular formula | C38H42N2O6 |
| XlogP | 6.4 |
| Topological Polar Surface Area | 61.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |