| ID | 1526 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis lutea |
| Type | Natural |
| Function | GABA-A antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Yang,Phytochem.,33,(1993),943 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1543 |
| Name | Bicuculline |
| Pubchem ID | 10237 |
| KEGG ID | C09364 |
| Source | Corydalis lutea |
| Type | Natural |
| Function | Convulsions |
| Drug Like Properties | Yes |
| Molecular Weight | 367.35 |
| Exact mass | 367.105587 |
| Molecular formula | C20H17NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 66.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 1 |
| IUPAC Name | (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[4,3-g][1,3]benzodioxol-8-one |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 |
| Drugpedia | wiki |
| References | 1. Yang,Phytochem.,33,(1993),943 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2318 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Corydalis lutea |
| Type | Natural |
| Function | Calcium channel blocker |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Yang,Phytochem.,33,(1993),943 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2365 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Corydalis lutea |
| Type | Natural |
| Function | Sedative |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Yang,Phytochem.,33,(1993),943 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |