ID | 3363 |
Name | Tetrandrine |
Pubchem ID | 73078 |
KEGG ID | C09654 |
Source | Cyclea burmannii |
Type | Natural |
Function | Anti-inflammatory |
Drug Like Properties | No |
Molecular Weight | 622.75 |
Exact mass | 622.304287 |
Molecular formula | C38H42N2O6 |
XlogP | 6.4 |
Topological Polar Surface Area | 61.9 |
H-Bond Donor | 0 |
H-Bond Acceptor | 8 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Bandara,Planta Med.,56,(1990),245 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3371 |
Name | Tetrandrine |
Pubchem ID | 73078 |
KEGG ID | C09654 |
Source | Cyclea burmannii |
Type | Natural |
Function | Antifibrotic |
Drug Like Properties | No |
Molecular Weight | 622.75 |
Exact mass | 622.304287 |
Molecular formula | C38H42N2O6 |
XlogP | 6.4 |
Topological Polar Surface Area | 61.9 |
H-Bond Donor | 0 |
H-Bond Acceptor | 8 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Bandara,Planta Med.,56,(1990),245 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |