| ID | 2322 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Dactylocapnos torulosa |
| Type | Natural |
| Function | Calcium channel blocker |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Zhang,Yaoxue Xuebao,25,(1990),604 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2369 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Dactylocapnos torulosa |
| Type | Natural |
| Function | Sedative |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Zhang,Yaoxue Xuebao,25,(1990),604 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2990 |
| Name | Protopine |
| Pubchem ID | 4970 |
| KEGG ID | C05189 |
| Source | Dactylocapnos torulosa |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | Yes |
| Molecular Weight | 353.37 |
| Exact mass | 353.126323 |
| Molecular formula | C20H19NO5 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 57.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Rucker,Phytochem., 36,(1994),519 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |