| ID | 1195 |
| Name | Apomorphine |
| Pubchem ID | 107882 |
| KEGG ID | D02004 |
| Source | Derivative of morphine |
| Type | Unknown |
| Function | Dopamine D2 agonist |
| Drug Like Properties | No |
| Molecular Weight | 625.58 |
| Exact mass | 624.215778 |
| Molecular formula | C34H38Cl2N2O5 |
| XlogP | N/A |
| Topological Polar Surface Area | 88.4 |
| H-Bond Donor | 7 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC=CC3=C2C1CC4=C3C(=C(C=C4)O)O.CN1CCC2=CC=CC3=C2C1CC4=C3C(=C(C=C4)O)O.O.Cl.Cl |
| Isomeric SMILE | CN1CCC2=CC=CC3=C2[C@H]1CC4=C3C(=C(C=C4)O)O.CN1CCC2=CC=CC3=C2[C@H]1CC4=C3C(=C(C=C4)O)O.O.Cl.Cl |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1196 |
| Name | Apomorphine |
| Pubchem ID | 6005 |
| KEGG ID | D07460 |
| Source | Derivative of morphine |
| Type | Unknown |
| Function | Dopamine D2 agonist |
| Drug Like Properties | Yes |
| Molecular Weight | 267.32 |
| Exact mass | 267.125929 |
| Molecular formula | C17H17NO2 |
| XlogP | 2.3 |
| Topological Polar Surface Area | 43.7 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC=CC3=C2C1CC4=C3C(=C(C=C4)O)O |
| Isomeric SMILE | CN1CCC2=CC=CC3=C2[C@H]1CC4=C3C(=C(C=C4)O)O |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1197 |
| Name | Apomorphine |
| Pubchem ID | 6931310 |
| KEGG ID | N/A |
| Source | Derivative of morphine |
| Type | Unknown |
| Function | Dopamine D2 agonist |
| Drug Like Properties | Yes |
| Molecular Weight | 268.33 |
| Exact mass | 268.133754 |
| Molecular formula | C17H18NO2+ |
| XlogP | 2.3 |
| Topological Polar Surface Area | 44.9 |
| H-Bond Donor | 3 |
| H-Bond Acceptor | 2 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[NH+]1CCC2=CC=CC3=C2C1CC4=C3C(=C(C=C4)O)O |
| Isomeric SMILE | C[NH+]1CCC2=CC=CC3=C2[C@H]1CC4=C3C(=C(C=C4)O)O |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |