ID | 2522 |
Name | Liriodenine |
Pubchem ID | 10144 |
KEGG ID | C09567 |
Source | Desmos longifolia |
Type | Natural |
Function | Antifungal |
Drug Like Properties | Yes |
Molecular Weight | 275.26 |
Exact mass | 275.058243 |
Molecular formula | C17H9NO3 |
XlogP | 3.4 |
Topological Polar Surface Area | 48.4 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Hossain,Fitoterapia,16,(1995),463 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3465 |
Name | Xylopine |
Pubchem ID | 160503 |
KEGG ID | C09670 |
Source | Desmos longifolia |
Type | Natural |
Function | Analgesic |
Drug Like Properties | Yes |
Molecular Weight | 295.33 |
Exact mass | 295.120843 |
Molecular formula | C18H17NO3 |
XlogP | 2.8 |
Topological Polar Surface Area | 39.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
Drugpedia | wiki |
References | 1. Hossain,Fitoterapia,16,(1995),463 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3477 |
Name | Xylopine |
Pubchem ID | 160503 |
KEGG ID | C09670 |
Source | Desmos longifolia |
Type | Natural |
Function | Leishmanicidal |
Drug Like Properties | Yes |
Molecular Weight | 295.33 |
Exact mass | 295.120843 |
Molecular formula | C18H17NO3 |
XlogP | 2.8 |
Topological Polar Surface Area | 39.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
Drugpedia | wiki |
References | 1. Hossain,Fitoterapia,16,(1995),463 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3489 |
Name | Xylopine |
Pubchem ID | 160503 |
KEGG ID | C09670 |
Source | Desmos longifolia |
Type | Natural |
Function | Antiplatelet |
Drug Like Properties | Yes |
Molecular Weight | 295.33 |
Exact mass | 295.120843 |
Molecular formula | C18H17NO3 |
XlogP | 2.8 |
Topological Polar Surface Area | 39.7 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
Drugpedia | wiki |
References | 1. Hossain,Fitoterapia,16,(1995),463 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |