ID | 2991 |
Name | Protopine |
Pubchem ID | 4970 |
KEGG ID | C05189 |
Source | Dicentra spectabilis |
Type | Natural |
Function | Antibacterial |
Drug Like Properties | Yes |
Molecular Weight | 353.37 |
Exact mass | 353.126323 |
Molecular formula | C20H19NO5 |
XlogP | 2.8 |
Topological Polar Surface Area | 57.2 |
H-Bond Donor | 0 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Kim,Shoyakugaku Zasshi,46,(1992),109 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3134 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicentra spectabilis |
Type | Natural |
Function | Anti-inflammatory |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 3148 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicentra spectabilis |
Type | Natural |
Function | Glutamate decarboxylase inhibitor |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 3162 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicentra spectabilis |
Type | Natural |
Function | Antibacterial |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 3176 |
Name | Sanguinarine |
Pubchem ID | 5154 |
KEGG ID | C06162 |
Source | Dicentra spectabilis |
Type | Natural |
Function | Cytotoxic |
Drug Like Properties | Yes |
Molecular Weight | 332.33 |
Exact mass | 332.092283 |
Molecular formula | C20H14NO4+ |
XlogP | 4.4 |
Topological Polar Surface Area | 40.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |