ID | 2108 |
Name | Erysotrine |
Pubchem ID | 442219 |
KEGG ID | C09423 |
Source | Erythrina oliviae |
Type | Natural |
Function | Neuromuscular blocking agent |
Drug Like Properties | Yes |
Molecular Weight | 313.39 |
Exact mass | 313.167794 |
Molecular formula | C19H23NO3 |
XlogP | 2.1 |
Topological Polar Surface Area | 30.9 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 3 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1CC23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
Isomeric SMILE | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
Drugpedia | wiki |
References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2135 |
Name | Erythratidine |
Pubchem ID | 442220 |
KEGG ID | C09424 |
Source | Erythrina oliviae |
Type | Natural |
Function | Neuromuscular blocking agent |
Drug Like Properties | Yes |
Molecular Weight | 331.41 |
Exact mass | 331.178358 |
Molecular formula | C19H25NO4 |
XlogP | 1.2 |
Topological Polar Surface Area | 51.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 3 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
Drugpedia | wiki |
References | 1. Hargreaves,Lloydia,37,(1974),569 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |