| ID | 1505 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina variegata |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Ghosal,Aust. J. Chem.,24,(1971),2733 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1514 |
| Name | Beta-erythroidine |
| Pubchem ID | 10074 |
| KEGG ID | C06532 |
| Source | Erythrina variegata |
| Type | Natural |
| Function | Ganglionic blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 273.33 |
| Exact mass | 273.136493 |
| Molecular formula | C16H19NO3 |
| XlogP | -0.2 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
| Drugpedia | wiki |
| References | 1. Ghosal,Aust. J. Chem.,24,(1971),2733 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |