| ID | 2967 |
| Name | Protopine |
| Pubchem ID | 22543 |
| KEGG ID | N/A |
| Source | Fumaria indica |
| Type | Natural |
| Function | Antioxidant |
| Drug Like Properties | No |
| Molecular Weight | 389.83 |
| Exact mass | 389.103 |
| Molecular formula | C20H20ClNO5 |
| XlogP | N/A |
| Topological Polar Surface Area | 57.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3.Cl |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2968 |
| Name | Protopine |
| Pubchem ID | 22543 |
| KEGG ID | N/A |
| Source | Fumaria indica |
| Type | Natural |
| Function | Analgesic |
| Drug Like Properties | No |
| Molecular Weight | 389.83 |
| Exact mass | 389.103 |
| Molecular formula | C20H20ClNO5 |
| XlogP | N/A |
| Topological Polar Surface Area | 57.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3.Cl |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2969 |
| Name | Protopine |
| Pubchem ID | 22543 |
| KEGG ID | N/A |
| Source | Fumaria indica |
| Type | Natural |
| Function | Antiplatelet |
| Drug Like Properties | No |
| Molecular Weight | 389.83 |
| Exact mass | 389.103 |
| Molecular formula | C20H20ClNO5 |
| XlogP | N/A |
| Topological Polar Surface Area | 57.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3.Cl |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2998 |
| Name | Protopine |
| Pubchem ID | 4970 |
| KEGG ID | C05189 |
| Source | Fumaria indica |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | Yes |
| Molecular Weight | 353.37 |
| Exact mass | 353.126323 |
| Molecular formula | C20H19NO5 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 57.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Tripathi,Phytochem.,31,(1992),2188 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3288 |
| Name | Stylopine |
| Pubchem ID | 440583 |
| KEGG ID | C05175 |
| Source | Fumaria indica |
| Type | Natural |
| Function | Unknown |
| Drug Like Properties | Yes |
| Molecular Weight | 323.34 |
| Exact mass | 323.115758 |
| Molecular formula | C19H17NO4 |
| XlogP | 3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CN2CC3=C(CC2C4=CC5=C(C=C41)OCO5)C=CC6=C3OCO6 |
| Isomeric SMILE | C1CN2CC3=C(C[C@H]2C4=CC5=C(C=C41)OCO5)C=CC6=C3OCO6 |
| Drugpedia | wiki |
| References | 1. Atta-ur-Rahmann,Fitoterapia,63,(1992),129 2. Tripathi,Phytochem.,31,(1992),2188 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |