| ID | 2156 |
| Name | Fagaridine |
| Pubchem ID | 177893 |
| KEGG ID | C09430 |
| Source | Macleaya cordata |
| Type | Natural |
| Function | Antimalarial |
| Drug Like Properties | Yes |
| Molecular Weight | 334.35 |
| Exact mass | 334.107933 |
| Molecular formula | C20H16NO4+ |
| XlogP | 4.3 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC(=C(C3=C1)O)OC)C=CC4=CC5=C(C=C42)OCO5 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Tolkachev,Pharm.Chem.J.,33,(1999),86 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2572 |
| Name | Macarpine |
| Pubchem ID | 440929 |
| KEGG ID | C06165 |
| Source | Macleaya cordata |
| Type | Natural |
| Function | Unknown |
| Drug Like Properties | Yes |
| Molecular Weight | 392.38 |
| Exact mass | 392.113412 |
| Molecular formula | C22H18NO6+ |
| XlogP | 4.4 |
| Topological Polar Surface Area | 59.3 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=CC2=C3C(=CC(=C2C4=C1C5=CC6=C(C=C5C(=C4)OC)OCO6)OC)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3139 |
| Name | Sanguinarine |
| Pubchem ID | 5154 |
| KEGG ID | C06162 |
| Source | Macleaya cordata |
| Type | Natural |
| Function | Anti-inflammatory |
| Drug Like Properties | Yes |
| Molecular Weight | 332.33 |
| Exact mass | 332.092283 |
| Molecular formula | C20H14NO4+ |
| XlogP | 4.4 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Tolkachev,Pharm.Chem.J.,33,(1999),86 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3153 |
| Name | Sanguinarine |
| Pubchem ID | 5154 |
| KEGG ID | C06162 |
| Source | Macleaya cordata |
| Type | Natural |
| Function | Glutamate decarboxylase inhibitor |
| Drug Like Properties | Yes |
| Molecular Weight | 332.33 |
| Exact mass | 332.092283 |
| Molecular formula | C20H14NO4+ |
| XlogP | 4.4 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Tolkachev,Pharm.Chem.J.,33,(1999),86 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3167 |
| Name | Sanguinarine |
| Pubchem ID | 5154 |
| KEGG ID | C06162 |
| Source | Macleaya cordata |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | Yes |
| Molecular Weight | 332.33 |
| Exact mass | 332.092283 |
| Molecular formula | C20H14NO4+ |
| XlogP | 4.4 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Tolkachev,Pharm.Chem.J.,33,(1999),86 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3181 |
| Name | Sanguinarine |
| Pubchem ID | 5154 |
| KEGG ID | C06162 |
| Source | Macleaya cordata |
| Type | Natural |
| Function | Cytotoxic |
| Drug Like Properties | Yes |
| Molecular Weight | 332.33 |
| Exact mass | 332.092283 |
| Molecular formula | C20H14NO4+ |
| XlogP | 4.4 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Tolkachev,Pharm.Chem.J.,33,(1999),86 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |