| ID | 2016 |
| Name | Dextromethorphan |
| Pubchem ID | 5362449 |
| KEGG ID | C06947 |
| Source | Methyl analog of DEXTRORPHAN |
| Type | Unknown |
| Function | NMDA antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 271.40 |
| Exact mass | 271.193614 |
| Molecular formula | C18H25NO |
| XlogP | 3.4 |
| Topological Polar Surface Area | 12.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 2 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC23CCCCC2C1CC4=C3C=C(C=C4)OC |
| Isomeric SMILE | CN1CC[C@]23CCCC[C@H]2[C@H]1CC4=C3C=C(C=C4)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2017 |
| Name | Dextromethorphan |
| Pubchem ID | 5362449 |
| KEGG ID | C06947 |
| Source | Methyl analog of DEXTRORPHAN |
| Type | Unknown |
| Function | Antitussive |
| Drug Like Properties | Yes |
| Molecular Weight | 271.40 |
| Exact mass | 271.193614 |
| Molecular formula | C18H25NO |
| XlogP | 3.4 |
| Topological Polar Surface Area | 12.5 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 2 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC23CCCCC2C1CC4=C3C=C(C=C4)OC |
| Isomeric SMILE | CN1CC[C@]23CCCC[C@H]2[C@H]1CC4=C3C=C(C=C4)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |