| ID | 2332 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Miliusa velutina |
| Type | Natural |
| Function | Calcium channel blocker |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Jumana,Biochem.Syst.Ecol.,28,(2000),483 2. Hasan,Nat.Prod.Lett.,14,(2000),393 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 2379 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Miliusa velutina |
| Type | Natural |
| Function | Sedative |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Jumana,Biochem.Syst.Ecol.,28,(2000),483 2. Hasan,Nat.Prod.Lett.,14,(2000),393 3. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 4. Source 5. Function 6. All Records |
| ID | 2536 |
| Name | Liriodenine |
| Pubchem ID | 10144 |
| KEGG ID | C09567 |
| Source | Miliusa velutina |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 275.26 |
| Exact mass | 275.058243 |
| Molecular formula | C17H9NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 48.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Jumana,Biochem.Syst.Ecol.,28,(2000),483 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3069 |
| Name | Reticuline |
| Pubchem ID | 10233 |
| KEGG ID | C12328 |
| Source | Miliusa velutina |
| Type | Natural |
| Function | Dopamine Antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 329.39 |
| Exact mass | 329.162708 |
| Molecular formula | C19H23NO4 |
| XlogP | 3 |
| Topological Polar Surface Area | 62.2 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | 1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)O)O)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Jumana,Biochem.Syst.Ecol.,28,(2000),483 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |