| ID | 1172 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Antimicrobial |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1180 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1211 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Convulsions |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1221 |
| Name | Armepavine |
| Pubchem ID | 442169 |
| KEGG ID | C09342 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Immunosuppressive |
| Drug Like Properties | Yes |
| Molecular Weight | 313.39 |
| Exact mass | 313.167794 |
| Molecular formula | C19H23NO3 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 41.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 4 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1804 |
| Name | Coclaurine |
| Pubchem ID | 160487 |
| KEGG ID | C06161 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Anti-HIV |
| Drug Like Properties | Yes |
| Molecular Weight | 285.34 |
| Exact mass | 285.136493 |
| Molecular formula | C17H19NO3 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 61.7 |
| H-Bond Donor | 3 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | (1S)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2C(NCCC2=C1)CC3=CC=C(C=C3)O)O |
| Isomeric SMILE | COC1=C(C=C2[C@@H](NCCC2=C1)CC3=CC=C(C=C3)O)O |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2761 |
| Name | Neferine |
| Pubchem ID | 159654 |
| KEGG ID | N/A |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Anti-HIV |
| Drug Like Properties | No |
| Molecular Weight | 624.77 |
| Exact mass | 624.319937 |
| Molecular formula | C38H44N2O6 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 72.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 10 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]-2-[[(1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)OC)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2762 |
| Name | Neferine |
| Pubchem ID | 159654 |
| KEGG ID | N/A |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Hypotensive |
| Drug Like Properties | No |
| Molecular Weight | 624.77 |
| Exact mass | 624.319937 |
| Molecular formula | C38H44N2O6 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 72.9 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 10 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]-2-[[(1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]phenol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)OC)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2837 |
| Name | Nuciferine |
| Pubchem ID | 10146 |
| KEGG ID | N/A |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | CNS depressant |
| Drug Like Properties | Yes |
| Molecular Weight | 295.38 |
| Exact mass | 295.157229 |
| Molecular formula | C19H21NO2 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 21.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC=CC=C43)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=CC=C43)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2838 |
| Name | Nuciferine |
| Pubchem ID | 10146 |
| KEGG ID | N/A |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Glutamic acid antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 295.38 |
| Exact mass | 295.157229 |
| Molecular formula | C19H21NO2 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 21.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC=CC=C43)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=CC=C43)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2839 |
| Name | Nuciferine |
| Pubchem ID | 10146 |
| KEGG ID | N/A |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Anti-HIV |
| Drug Like Properties | Yes |
| Molecular Weight | 295.38 |
| Exact mass | 295.157229 |
| Molecular formula | C19H21NO2 |
| XlogP | 3.4 |
| Topological Polar Surface Area | 21.7 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC=CC=C43)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=CC=C43)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2959 |
| Name | Pronuciferine |
| Pubchem ID | 200480 |
| KEGG ID | C09611 |
| Source | Nelumbo nucifera |
| Type | Natural |
| Function | Anaesthetic |
| Drug Like Properties | Yes |
| Molecular Weight | 311.37 |
| Exact mass | 311.152144 |
| Molecular formula | C19H21NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 38.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |