ID | 1194 |
Name | (-)-Apoglaziovine |
Pubchem ID | 442167 |
KEGG ID | C09340 |
Source | Ocotea glaziovii |
Type | Natural |
Function | Hypotensive |
Drug Like Properties | Yes |
Molecular Weight | 297.35 |
Exact mass | 297.136493 |
Molecular formula | C18H19NO3 |
XlogP | 2.3 |
Topological Polar Surface Area | 52.9 |
H-Bond Donor | 2 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C=C(C=C4)O)O)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=C3C=C(C=C4)O)O)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 1656 |
Name | (-)-Caaverine |
Pubchem ID | 23335 |
KEGG ID | C09368 |
Source | Ocotea glaziovii |
Type | Natural |
Function | Toxic |
Drug Like Properties | Yes |
Molecular Weight | 267.32 |
Exact mass | 267.125929 |
Molecular formula | C17H17NO2 |
XlogP | 2.6 |
Topological Polar Surface Area | 41.5 |
H-Bond Donor | 2 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C3C(CC4=CC=CC=C42)NCCC3=C1)O |
Isomeric SMILE | COC1=C(C2=C3[C@@H](CC4=CC=CC=C42)NCCC3=C1)O |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2245 |
Name | Glaziovine |
Pubchem ID | 442245 |
KEGG ID | C09457 |
Source | Ocotea glaziovii |
Type | Natural |
Function | Antidepressant |
Drug Like Properties | Yes |
Molecular Weight | 297.35 |
Exact mass | 297.136493 |
Molecular formula | C18H19NO3 |
XlogP | 2.2 |
Topological Polar Surface Area | 49.8 |
H-Bond Donor | 1 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)O)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)O)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |