| ID | 1194 |
| Name | (-)-Apoglaziovine |
| Pubchem ID | 442167 |
| KEGG ID | C09340 |
| Source | Ocotea glaziovii |
| Type | Natural |
| Function | Hypotensive |
| Drug Like Properties | Yes |
| Molecular Weight | 297.35 |
| Exact mass | 297.136493 |
| Molecular formula | C18H19NO3 |
| XlogP | 2.3 |
| Topological Polar Surface Area | 52.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C=C(C=C4)O)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=C3C=C(C=C4)O)O)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1656 |
| Name | (-)-Caaverine |
| Pubchem ID | 23335 |
| KEGG ID | C09368 |
| Source | Ocotea glaziovii |
| Type | Natural |
| Function | Toxic |
| Drug Like Properties | Yes |
| Molecular Weight | 267.32 |
| Exact mass | 267.125929 |
| Molecular formula | C17H17NO2 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 41.5 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C3C(CC4=CC=CC=C42)NCCC3=C1)O |
| Isomeric SMILE | COC1=C(C2=C3[C@@H](CC4=CC=CC=C42)NCCC3=C1)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2245 |
| Name | Glaziovine |
| Pubchem ID | 442245 |
| KEGG ID | C09457 |
| Source | Ocotea glaziovii |
| Type | Natural |
| Function | Antidepressant |
| Drug Like Properties | Yes |
| Molecular Weight | 297.35 |
| Exact mass | 297.136493 |
| Molecular formula | C18H19NO3 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)O)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |