| ID | 1144 |
| Name | Alpinine |
| Pubchem ID | 442162 |
| KEGG ID | C09331 |
| Source | Papaver alpinum |
| Type | Natural |
| Function | Unknown |
| Drug Like Properties | Yes |
| Molecular Weight | 415.48 |
| Exact mass | 415.199488 |
| Molecular formula | C23H29NO6 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 58.6 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 5 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C3C1C4=C(C(O3)OC)C(=C(C=C4)OC)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]3[C@H]1C4=C([C@H](O3)OC)C(=C(C=C4)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1147 |
| Name | Amurensine |
| Pubchem ID | 442164 |
| KEGG ID | C09333 |
| Source | Papaver alpinum |
| Type | Natural |
| Function | Tranquilizer |
| Drug Like Properties | Yes |
| Molecular Weight | 325.36 |
| Exact mass | 325.131408 |
| Molecular formula | C19H19NO4 |
| XlogP | 2.7 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CC2C3=CC(=C(C=C3CC1C4=CC5=C(C=C24)OCO5)OC)O |
| Isomeric SMILE | CN1C[C@@H]2C3=CC(=C(C=C3C[C@H]1C4=CC5=C(C=C24)OCO5)OC)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |