| ID | 1364 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Antiparasitic |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1416 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1468 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Antidiarrheal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1972 |
| Name | Cularine |
| Pubchem ID | 94150 |
| KEGG ID | C09411 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 3.3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=C3C1CC4=CC(=C(C=C4OC3=C(C=C2)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=C3[C@@H]1CC4=CC(=C(C=C4OC3=C(C=C2)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Sariyar,Planta Med.,56,(1990),232 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2340 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Calcium channel blocker |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Sariyar,Planta Med.,56,(1990),232 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2387 |
| Name | Isocorydine |
| Pubchem ID | 10143 |
| KEGG ID | C09549 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Sedative |
| Drug Like Properties | Yes |
| Molecular Weight | 341.40 |
| Exact mass | 341.162708 |
| Molecular formula | C20H23NO4 |
| XlogP | 2.6 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC |
| Drugpedia | wiki |
| References | 1. Sariyar,Planta Med.,56,(1990),232 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2744 |
| Name | Narcein |
| Pubchem ID | 8564 |
| KEGG ID | C09591 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Antitussive |
| Drug Like Properties | Yes |
| Molecular Weight | 445.46 |
| Exact mass | 445.173667 |
| Molecular formula | C23H27NO8 |
| XlogP | 0.5 |
| Topological Polar Surface Area | 104 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 9 |
| Rotational Bond Count | 10 |
| IUPAC Name | 6-[2-[6-(2-dimethylaminoethyl)-4-methoxy-1,3-benzodioxol-5-yl]acetyl]-2,3-dimethoxybenzoic acid |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN(C)CCC1=CC2=C(C(=C1CC(=O)C3=C(C(=C(C=C3)OC)OC)C(=O)O)OC)OCO2 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Sariyar,Planta Med.,56,(1990),232 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3022 |
| Name | Protopine |
| Pubchem ID | 4970 |
| KEGG ID | C05189 |
| Source | Papaver rhopalothece |
| Type | Natural |
| Function | Antibacterial |
| Drug Like Properties | Yes |
| Molecular Weight | 353.37 |
| Exact mass | 353.126323 |
| Molecular formula | C20H19NO5 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 57.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Sariyar,Planta Med.,56,(1990),232 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |