| ID | 2899 |
| Name | Papaverine |
| Pubchem ID | 4680 |
| KEGG ID | C06533 |
| Source | Rauvolfia serpentina |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.9 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 6 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2901 |
| Name | Papaverine |
| Pubchem ID | 4680 |
| KEGG ID | C06533 |
| Source | Rauvolfia serpentina |
| Type | Natural |
| Function | Vasodilator |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.9 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 6 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2903 |
| Name | Papaverine |
| Pubchem ID | 4680 |
| KEGG ID | C06533 |
| Source | Rauvolfia serpentina |
| Type | Natural |
| Function | Antitussive |
| Drug Like Properties | Yes |
| Molecular Weight | 339.39 |
| Exact mass | 339.147058 |
| Molecular formula | C20H21NO4 |
| XlogP | 3.9 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 6 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |