ID | 1094 |
Name | Aknadicine |
Pubchem ID | 442156 |
KEGG ID | C09325 |
Source | Stephania hernandifolia |
Type | Natural |
Function | Antimicrobial |
Drug Like Properties | Yes |
Molecular Weight | 345.39 |
Exact mass | 345.157623 |
Molecular formula | C19H23NO5 |
XlogP | 1.3 |
Topological Polar Surface Area | 77 |
H-Bond Donor | 2 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 3 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C2=C(CCC34C2(CCN3)CC(=O)C(=C4OC)OC)C=C1)O |
Isomeric SMILE | COC1=C(C2=C(CC[C@@]34[C@@]2(CCN3)CC(=O)C(=C4OC)OC)C=C1)O |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2269 |
Name | Hernandezine |
Pubchem ID | 72343 |
KEGG ID | C09461 |
Source | Stephania hernandifolia |
Type | Natural |
Function | Anti-inflammatory |
Drug Like Properties | No |
Molecular Weight | 652.78 |
Exact mass | 652.314852 |
Molecular formula | C39H44N2O7 |
XlogP | 6.4 |
Topological Polar Surface Area | 71.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 9 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(CCN6C)C(=C(C(=C7O3)OC)OC)OC)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(CCN6C)C(=C(C(=C7O3)OC)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |