| ID | 1094 |
| Name | Aknadicine |
| Pubchem ID | 442156 |
| KEGG ID | C09325 |
| Source | Stephania hernandifolia |
| Type | Natural |
| Function | Antimicrobial |
| Drug Like Properties | Yes |
| Molecular Weight | 345.39 |
| Exact mass | 345.157623 |
| Molecular formula | C19H23NO5 |
| XlogP | 1.3 |
| Topological Polar Surface Area | 77 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 6 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C(CCC34C2(CCN3)CC(=O)C(=C4OC)OC)C=C1)O |
| Isomeric SMILE | COC1=C(C2=C(CC[C@@]34[C@@]2(CCN3)CC(=O)C(=C4OC)OC)C=C1)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2269 |
| Name | Hernandezine |
| Pubchem ID | 72343 |
| KEGG ID | C09461 |
| Source | Stephania hernandifolia |
| Type | Natural |
| Function | Anti-inflammatory |
| Drug Like Properties | No |
| Molecular Weight | 652.78 |
| Exact mass | 652.314852 |
| Molecular formula | C39H44N2O7 |
| XlogP | 6.4 |
| Topological Polar Surface Area | 71.1 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 9 |
| Rotational Bond Count | 5 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(CCN6C)C(=C(C(=C7O3)OC)OC)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(CCN6C)C(=C(C(=C7O3)OC)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |