ID | 1693 |
Name | C-Curarine |
Pubchem ID | 5281386 |
KEGG ID | C09144 |
Source | Strychnos mittschelichii |
Type | Natural |
Function | Toxic |
Drug Like Properties | No |
Molecular Weight | 596.80 |
Exact mass | 596.351512 |
Molecular formula | C40H44N4O+2 |
XlogP | 3.7 |
Topological Polar Surface Area | 15.7 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7=CC=CC=C7C89C61C(=CN(C53O1)C1=CC=CC=C41)C1CC8[N+](CC9)(CC1=CC)C)C |
Isomeric SMILE | C/C=C/1[C@H]2C3=CN4[C@@]56O[C@]37N(C8=CC=CC=C8[C@]79[C@H](C2)[N@+](C1)(CC9)C)C=C5[C@@H]1/C(=CC)/C[N@+]2([C@H]([C@]6(C3=CC=CC=C43)CC2)C1)C |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |
ID | 1698 |
Name | C-Curarine |
Pubchem ID | 5281386 |
KEGG ID | C09144 |
Source | Strychnos mittschelichii |
Type | Natural |
Function | Neuromuscular blocking agent |
Drug Like Properties | No |
Molecular Weight | 596.80 |
Exact mass | 596.351512 |
Molecular formula | C40H44N4O+2 |
XlogP | 3.7 |
Topological Polar Surface Area | 15.7 |
H-Bond Donor | 0 |
H-Bond Acceptor | 3 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CC=C1C[N+]2(CCC34C2CC1C5=CN6C7=CC=CC=C7C89C61C(=CN(C53O1)C1=CC=CC=C41)C1CC8[N+](CC9)(CC1=CC)C)C |
Isomeric SMILE | C/C=C/1[C@H]2C3=CN4[C@@]56O[C@]37N(C8=CC=CC=C8[C@]79[C@H](C2)[N@+](C1)(CC9)C)C=C5[C@@H]1/C(=CC)/C[N@+]2([C@H]([C@]6(C3=CC=CC=C43)CC2)C1)C |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 2. Source 3. Function 4. All Records |