ID | 3394 |
Name | Thalidasine |
Pubchem ID | 159795 |
KEGG ID | C09656 |
Source | Thalictrum fargestii |
Type | Natural |
Function | Antimicrobial |
Drug Like Properties | No |
Molecular Weight | 652.78 |
Exact mass | 652.314852 |
Molecular formula | C39H44N2O7 |
XlogP | 6.4 |
Topological Polar Surface Area | 71.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 9 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C4)OC)OC5=CC=C(CC6C7=CC(=C(C(=C7CCN6C)O3)OC)OC)C=C5)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C4)OC)OC5=CC=C(C[C@H]6C7=CC(=C(C(=C7CCN6C)O3)OC)OC)C=C5)OC)OC |
Drugpedia | wiki |
References | 1. Wu,Zhongguo Yaoke Daxue Xuebao,23,(1991),177 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3400 |
Name | Thalidasine |
Pubchem ID | 159795 |
KEGG ID | C09656 |
Source | Thalictrum fargestii |
Type | Natural |
Function | Hypotensive |
Drug Like Properties | No |
Molecular Weight | 652.78 |
Exact mass | 652.314852 |
Molecular formula | C39H44N2O7 |
XlogP | 6.4 |
Topological Polar Surface Area | 71.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 9 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C4)OC)OC5=CC=C(CC6C7=CC(=C(C(=C7CCN6C)O3)OC)OC)C=C5)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C4)OC)OC5=CC=C(C[C@H]6C7=CC(=C(C(=C7CCN6C)O3)OC)OC)C=C5)OC)OC |
Drugpedia | wiki |
References | 1. Wu,Zhongguo Yaoke Daxue Xuebao,23,(1991),177 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |