| ID | 1091 |
| Name | Adiantifoline |
| Pubchem ID | 167937 |
| KEGG ID | C09323 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Hypotensive |
| Drug Like Properties | No |
| Molecular Weight | 726.85 |
| Exact mass | 726.351631 |
| Molecular formula | C42H50N2O9 |
| XlogP | 6.6 |
| Topological Polar Surface Area | 89.6 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 11 |
| Rotational Bond Count | 12 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=C(C(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC5=CC(=C(C=C5CC6C7=CC(=C(C=C7CCN6C)OC)OC)OC)OC)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=C(C(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)OC5=CC(=C(C=C5C[C@H]6C7=CC(=C(C=C7CCN6C)OC)OC)OC)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1204 |
| Name | (-)-Argemonine |
| Pubchem ID | 442168 |
| KEGG ID | C09341 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antiarrhythmic |
| Drug Like Properties | Yes |
| Molecular Weight | 355.43 |
| Exact mass | 355.178358 |
| Molecular formula | C21H25NO4 |
| XlogP | 3.3 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1C2CC3=CC(=C(C=C3C1CC4=CC(=C(C=C24)OC)OC)OC)OC |
| Isomeric SMILE | CN1[C@H]2CC3=CC(=C(C=C3[C@@H]1CC4=CC(=C(C=C24)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 1373 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antiparasitic |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1425 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1477 |
| Name | Berberine |
| Pubchem ID | 2353 |
| KEGG ID | D06817 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antidiarrheal |
| Drug Like Properties | Yes |
| Molecular Weight | 336.36 |
| Exact mass | 336.123583 |
| Molecular formula | C20H18NO4+ |
| XlogP | 3.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1924 |
| Name | Columbamine |
| Pubchem ID | 72310 |
| KEGG ID | C01795 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Dopamine Agonist |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)O)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 1925 |
| Name | Columbamine |
| Pubchem ID | 72310 |
| KEGG ID | C01795 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Dopamine Agonist |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 3,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)O)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2487 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,57,(1992),573 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2612 |
| Name | Magnoflorine |
| Pubchem ID | 73337 |
| KEGG ID | C09581 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Hypotensive |
| Drug Like Properties | Yes |
| Molecular Weight | 342.41 |
| Exact mass | 342.170533 |
| Molecular formula | C20H24NO4+ |
| XlogP | 2.7 |
| Topological Polar Surface Area | 58.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,57,(1992),573 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2660 |
| Name | Magnoflorine |
| Pubchem ID | 73337 |
| KEGG ID | C09581 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antioxidant |
| Drug Like Properties | Yes |
| Molecular Weight | 342.41 |
| Exact mass | 342.170533 |
| Molecular formula | C20H24NO4+ |
| XlogP | 2.7 |
| Topological Polar Surface Area | 58.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Drugpedia | wiki |
| References | 1. Slavik,Collect.Czech.Chem.Commun.,57,(1992),573 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2850 |
| Name | OBABERINE |
| Pubchem ID | 100231 |
| KEGG ID | C09596 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Antitrypanosomal |
| Drug Like Properties | No |
| Molecular Weight | 622.75 |
| Exact mass | 622.304287 |
| Molecular formula | C38H42N2O6 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 61.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=CC(=C(C=C7CCN6C)OC)O3)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@@H]6C7=CC(=C(C=C7CCN6C)OC)O3)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Kirimer,Planta Med.,57,(1991),587 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3388 |
| Name | Thalicberine |
| Pubchem ID | 5321904 |
| KEGG ID | N/A |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Unknown |
| Drug Like Properties | No |
| Molecular Weight | 606.75 |
| Exact mass | 606.309372 |
| Molecular formula | C38H42N2O5 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 63.6 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 7 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(C3)C(=C(C=C7CCN6C)OC)OC)O)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 3411 |
| Name | Thalmidine |
| Pubchem ID | 100230 |
| KEGG ID | C09590 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Anti-inflammatory |
| Drug Like Properties | No |
| Molecular Weight | 622.75 |
| Exact mass | 622.304287 |
| Molecular formula | C38H42N2O6 |
| XlogP | 6.7 |
| Topological Polar Surface Area | 61.9 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 8 |
| Rotational Bond Count | 4 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC3=C(C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Isomeric SMILE | CN1CCC2=CC3=C(C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 3501 |
| Name | Xylopinine |
| Pubchem ID | 226520 |
| KEGG ID | C09671 |
| Source | Thalictrum minus |
| Type | Natural |
| Function | Adrenergic alpha-blocker |
| Drug Like Properties | Yes |
| Molecular Weight | 355.43 |
| Exact mass | 355.178358 |
| Molecular formula | C21H25NO4 |
| XlogP | 3.2 |
| Topological Polar Surface Area | 40.2 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | (13aS)-2,3,10,11-tetramethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2C3CC4=CC(=C(C=C4CN3CCC2=C1)OC)OC)OC |
| Isomeric SMILE | COC1=C(C=C2[C@@H]3CC4=CC(=C(C=C4CN3CCC2=C1)OC)OC)OC |
| Drugpedia | wiki |
| References | 1. Lou,Planta Med.,58,(1992),114 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |