ID | 1205 |
Name | (-)-Argemonine |
Pubchem ID | 442168 |
KEGG ID | C09341 |
Source | Thalictrum rugosum |
Type | Natural |
Function | Antiarrhythmic |
Drug Like Properties | Yes |
Molecular Weight | 355.43 |
Exact mass | 355.178358 |
Molecular formula | C21H25NO4 |
XlogP | 3.3 |
Topological Polar Surface Area | 40.2 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1C2CC3=CC(=C(C=C3C1CC4=CC(=C(C=C24)OC)OC)OC)OC |
Isomeric SMILE | CN1[C@H]2CC3=CC(=C(C=C3[C@@H]1CC4=CC(=C(C=C24)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 3112 |
Name | Rugosinone |
Pubchem ID | 442350 |
KEGG ID | C09634 |
Source | Thalictrum rugosum |
Type | Natural |
Function | Unknown |
Drug Like Properties | Yes |
Molecular Weight | 353.33 |
Exact mass | 353.089937 |
Molecular formula | C19H15NO6 |
XlogP | 3.7 |
Topological Polar Surface Area | 87.1 |
H-Bond Donor | 1 |
H-Bond Acceptor | 7 |
Rotational Bond Count | 4 |
IUPAC Name | [1,3]dioxolo[4,5-g]isoquinolin-5-yl-(2-hydroxy-3,4-dimethoxyphenyl)methanone |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1=C(C(=C(C=C1)C(=O)C2=NC=CC3=CC4=C(C=C32)OCO4)O)OC |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 3381 |
Name | Thalcimine |
Pubchem ID | 362568 |
KEGG ID | C09661 |
Source | Thalictrum rugosum |
Type | Natural |
Function | Anticancer |
Drug Like Properties | No |
Molecular Weight | 636.73 |
Exact mass | 636.283552 |
Molecular formula | C38H40N2O7 |
XlogP | 5.8 |
Topological Polar Surface Area | 80.2 |
H-Bond Donor | 0 |
H-Bond Acceptor | 9 |
Rotational Bond Count | 5 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=C3C1CC4=CC(=C(C=C4)OC)OC5=CC=C(CC6=NCCC7=CC(=C(C=C76)OC3=C(C(=C2OC)OC)OC)OC)C=C5 |
Isomeric SMILE | CN1CCC2=C3[C@@H]1CC4=CC(=C(C=C4)OC)OC5=CC=C(CC6=NCCC7=CC(=C(C=C76)OC3=C(C(=C2OC)OC)OC)OC)C=C5 |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |