| ID | 1167 |
| Name | Anolobine |
| Pubchem ID | 164710 |
| KEGG ID | C09338 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Antimicrobial |
| Drug Like Properties | Yes |
| Molecular Weight | 281.31 |
| Exact mass | 281.105193 |
| Molecular formula | C17H15NO3 |
| XlogP | 2.5 |
| Topological Polar Surface Area | 50.7 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=C(C=CC(=C3)O)C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=C(C=CC(=C3)O)C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1176 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Antimicrobial |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1184 |
| Name | Anonaine |
| Pubchem ID | 160597 |
| KEGG ID | C09339 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Smooth muscle relaxant |
| Drug Like Properties | Yes |
| Molecular Weight | 265.31 |
| Exact mass | 265.110279 |
| Molecular formula | C17H15NO2 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 30.5 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 0 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C1CNC2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Isomeric SMILE | C1CN[C@@H]2CC3=CC=CC=C3C4=C2C1=CC5=C4OCO5 |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 1258 |
| Name | Backebergine |
| Pubchem ID | 177578 |
| KEGG ID | C09348 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Unknown |
| Drug Like Properties | Yes |
| Molecular Weight | 189.21 |
| Exact mass | 189.078979 |
| Molecular formula | C11H11NO2 |
| XlogP | 2 |
| Topological Polar Surface Area | 31.4 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 3 |
| Rotational Bond Count | 2 |
| IUPAC Name | 6,7-dimethoxyisoquinoline |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2C=NC=CC2=C1)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,65,(2004),939 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2258 |
| Name | Glaziovine |
| Pubchem ID | 442245 |
| KEGG ID | C09457 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Antidepressant |
| Drug Like Properties | Yes |
| Molecular Weight | 297.35 |
| Exact mass | 297.136493 |
| Molecular formula | C18H19NO3 |
| XlogP | 2.2 |
| Topological Polar Surface Area | 49.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC34C=CC(=O)C=C4)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@H]1CC34C=CC(=O)C=C4)O)OC |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2488 |
| Name | Jatrorrhizine |
| Pubchem ID | 72323 |
| KEGG ID | C09553 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Antifungal |
| Drug Like Properties | Yes |
| Molecular Weight | 338.38 |
| Exact mass | 338.139233 |
| Molecular formula | C20H20NO4+ |
| XlogP | 3.4 |
| Topological Polar Surface Area | 51.8 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | 2,9,10-trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)O)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Source 2. Function 3. All Records |
| ID | 2553 |
| Name | Longifolonine |
| Pubchem ID | 442312 |
| KEGG ID | C09569 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Unknown |
| Drug Like Properties | Yes |
| Molecular Weight | 297.31 |
| Exact mass | 297.100108 |
| Molecular formula | C17H15NO4 |
| XlogP | 2.1 |
| Topological Polar Surface Area | 79.1 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | (7-hydroxy-6-methoxy-3,4-dihydroisoquinolin-1-yl)-(4-hydroxyphenyl)methanone |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2C(=C1)CCN=C2C(=O)C3=CC=C(C=C3)O)O |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2618 |
| Name | Magnoflorine |
| Pubchem ID | 73337 |
| KEGG ID | C09581 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Hypotensive |
| Drug Like Properties | Yes |
| Molecular Weight | 342.41 |
| Exact mass | 342.170533 |
| Molecular formula | C20H24NO4+ |
| XlogP | 2.7 |
| Topological Polar Surface Area | 58.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,65,(2004),939 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 2666 |
| Name | Magnoflorine |
| Pubchem ID | 73337 |
| KEGG ID | C09581 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Antioxidant |
| Drug Like Properties | Yes |
| Molecular Weight | 342.41 |
| Exact mass | 342.170533 |
| Molecular formula | C20H24NO4+ |
| XlogP | 2.7 |
| Topological Polar Surface Area | 58.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Isomeric SMILE | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,65,(2004),939 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3080 |
| Name | Reticuline |
| Pubchem ID | 10233 |
| KEGG ID | C12328 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Dopamine Antagonist |
| Drug Like Properties | Yes |
| Molecular Weight | 329.39 |
| Exact mass | 329.162708 |
| Molecular formula | C19H23NO4 |
| XlogP | 3 |
| Topological Polar Surface Area | 62.2 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 4 |
| IUPAC Name | 1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)O)O)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3107 |
| Name | (R)-N-Methylcoclaurine |
| Pubchem ID | 440595 |
| KEGG ID | C05243 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Unknown |
| Drug Like Properties | Yes |
| Molecular Weight | 299.36 |
| Exact mass | 299.152144 |
| Molecular formula | C18H21NO3 |
| XlogP | 3 |
| Topological Polar Surface Area | 52.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 3 |
| IUPAC Name | (1R)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)O)OC |
| Isomeric SMILE | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)O)O)OC |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3471 |
| Name | Xylopine |
| Pubchem ID | 160503 |
| KEGG ID | C09670 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Analgesic |
| Drug Like Properties | Yes |
| Molecular Weight | 295.33 |
| Exact mass | 295.120843 |
| Molecular formula | C18H17NO3 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 39.7 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
| Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3483 |
| Name | Xylopine |
| Pubchem ID | 160503 |
| KEGG ID | C09670 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Leishmanicidal |
| Drug Like Properties | Yes |
| Molecular Weight | 295.33 |
| Exact mass | 295.120843 |
| Molecular formula | C18H17NO3 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 39.7 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
| Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
| ID | 3495 |
| Name | Xylopine |
| Pubchem ID | 160503 |
| KEGG ID | C09670 |
| Source | Xylopia parviflora |
| Type | Natural |
| Function | Antiplatelet |
| Drug Like Properties | Yes |
| Molecular Weight | 295.33 |
| Exact mass | 295.120843 |
| Molecular formula | C18H17NO3 |
| XlogP | 2.8 |
| Topological Polar Surface Area | 39.7 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=CC2=C(C=C1)C3=C4C(C2)NCCC4=CC5=C3OCO5 |
| Isomeric SMILE | COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5 |
| Drugpedia | wiki |
| References | 1. Nishiyama,Phytochem.,67,(2006),2671 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |