| ID | 2776 |
| Name | Nitidine |
| Pubchem ID | 4501 |
| KEGG ID | C09595 |
| Source | Zanthoxylum clava-herculis |
| Type | Natural |
| Function | Anticancer |
| Drug Like Properties | Yes |
| Molecular Weight | 348.37 |
| Exact mass | 348.123583 |
| Molecular formula | C21H18NO4+ |
| XlogP | 4.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2780 |
| Name | Nitidine |
| Pubchem ID | 4501 |
| KEGG ID | C09595 |
| Source | Zanthoxylum clava-herculis |
| Type | Natural |
| Function | Toxic |
| Drug Like Properties | Yes |
| Molecular Weight | 348.37 |
| Exact mass | 348.123583 |
| Molecular formula | C21H18NO4+ |
| XlogP | 4.6 |
| Topological Polar Surface Area | 40.8 |
| H-Bond Donor | 0 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 2 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC)OC |
| Isomeric SMILE | N/A |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |