A database of hormones and their receptors |
|
|
|
|
|
|
HMRbase accession number | 1007 |
PubChem ID | 11222 |
Hormone name | 18-hydroxycorticosterone |
Description | 11 beta,18,21-Trihydroxypregn-4-ene-3,20-dione. |
Synonyms | 18-HYDROXYCORTICOSTERONE 11beta,18,21-Trihydroxypregn-4-ene-3,20-dione |
Molecular weight | 362.46 |
Molecular formula | C21H30O5 |
IUPAC Name | (8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-13-(hydroxymethyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren- 3-one |
Canonical smiles | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)CO)O |
Isomeric smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@H]4C(=O)CO)CO)O
|
Structure | |
PDB file | |
SDF file | |
MOL file | |
PDB ID | N/A |
KEGG ID | C01124 |
HMDB ID | HMDB00319 |
Melting Point | N/A |
Log P | N/A |
Water Solubility | N/A |
DrugBank ID | N/A |
Drugpedia | wiki |
Receptor | N/A |
Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
References | Pubchem |