A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1163 |
| PubChem ID | 6452574 |
| Hormone name | 16alpha-hydroxypregnenolone |
| Description | RN given refers to (3beta,16alpha)-isomer |
| Synonyms | 16-alpha-Hydroxypregnenolone 3beta,16alpha-Dihydroxypregn-5-en-20-one (3beta,16alpha)-3,16-dihydroxypregn-5-en-20-one Pregn-5-en-20-one, 3,16-dihydroxy-, (3beta,16alpha)- 3 beta,16 alpha-dihydroxypregn-5-en-20-one |
| Molecular weight | 332.48 |
| Molecular formula | C21H32O3 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13S,14S,16R,17R)-3,16-dihydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| Canonical smiles | CC(=O)C1C(CC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)O |
| Isomeric smiles | CC(=O)[C@H]1[C@@H](C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C06390 |
| HMDB ID | HMDB00315 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |