A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1169 |
| PubChem ID | 192735 |
| Hormone name | 17, 21-dihydroxypregnenolone |
| Description | |
| Synonyms | 17, 21-Dihydroxypregnenolone 3beta,17,21-Trihydroxypregn-5-en-20-one |
| Molecular weight | 348.48 |
| Molecular formula | C21H32O4 |
| IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone |
| Canonical smiles | CC12CCC(CC1=CCC3C2CCC4(C3CCC4(C(=O)CO)O)C)O |
| Isomeric smiles | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | N/A |
| HMDB ID | HMDB00382 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |