A database of hormones and their receptors| A database of hormones and their receptors |
|
|
|
|
|
|
|
| HMRbase accession number | 1225 |
| PubChem ID | 246876 |
| Hormone name | 16-ketoestrone |
| Description | structure |
| Synonyms | 16-Ketoestrone 16-Oxoestrone 3-Hydroxy-1,3,5(10)-estratriene-16,17-dione Estra-1,3,5(10)-triene-16,17-dione, 3-hydroxy- |
| Molecular weight | 284.35 |
| Molecular formula | C18H20O3 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-16,17-dione |
| Canonical smiles | CC12CCC3C(C1CC(=O)C2=O)CCC4=C3C=CC(=C4)O |
| Isomeric smiles | C[C@]12CC[C@H]3[C@H]([C@@H]1CC(=O)C2=O)CCC4=C3C=CC(=C4)O
|
| Structure | |
| PDB file | |
| SDF file | |
| MOL file | |
| PDB ID | N/A |
| KEGG ID | C14441 |
| HMDB ID | HMDB00372 |
| Melting Point | N/A |
| Log P | N/A |
| Water Solubility | N/A |
| DrugBank ID | N/A |
| Drugpedia | wiki |
| Receptor | N/A |
| Comments | !Receptor for this Hormone are either unknown or have not yet been curated |
| References | HMDB |